Argentinine

Catalog Number	ACM16625573
CAS Number	16625-57-3
Structure
Synonyms	1-[2-(Dimethylamino)ethyl]-4-methoxyphenanthren-3-ol
Molecular Weight	295.4
InChI	InChI=1S/C19H21NO2/c1-20(2)11-10-14-12-17(21)19(22-3)18-15-7-5-4-6-13(15)8-9-16(14)18/h4-9,12,21H,10-11H2,1-3H3
InChI Key	HCXNUWJYBNHDAE-UHFFFAOYSA-N
Purity	95%+
Complexity	359
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	295.157228913
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	295.157228913
PhysicalState	Oil
Rotatable Bond Count	4
Topological Polar Surface Area	32.7 Ų

Custom Q&A

What is the chemical name of Argentinine?

The chemical name of Argentinine is 1-[2-(Dimethylamino)ethyl]-4-methoxyphenanthren-3-ol.

What is the synonym for Argentinine?

The synonym for Argentinine is 1-[2-(Dimethylamino)ethyl]-4-methoxy-3-phenanthrol.

What is the CAS number for Argentinine?

The CAS number for Argentinine is 16625-57-3.

What is the molecular formula of Argentinine?

The molecular formula of Argentinine is C19H21NO2.

What is the molecular weight of Argentinine?

The molecular weight of Argentinine is 295.38.

What is the predicted boiling point of Argentinine?

The predicted boiling point of Argentinine is 489.1±35.0 °C.

What is the predicted density of Argentinine?

The predicted density of Argentinine is 1.166±0.06 g/cm3.

What is the predicted pka value of Argentinine?

The predicted pka value of Argentinine is 9.07±0.30.

In which plant is Argentinine found?

Argentinine is found in Annona montana.

What is the primary usage of Argentinine?

The primary usage of Argentinine is as a cytotoxic alkaloid.

※ Please kindly note that our products are for research use only.