Aristolactam AIIIa

Catalog Number	ACM97399912
CAS Number	97399-91-2
Molecular Weight	281.26
InChI	InChI=1S/C16H11NO4/c1-21-15-12(19)6-10-13-11(17-16(10)20)4-7-2-3-8(18)5-9(7)14(13)15/h2-6,18-19H,1H3,(H,17,20)
InChI Key	PFXGXKFPTAJYHV-UHFFFAOYSA-N
Melting Point	>300 °C
Purity	95%+
Complexity	442
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	281.06880783
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	3
Monoisotopic Mass	281.06880783
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	78.8 Ų

Custom Q&A

What is the molecular formula of Aristolactam AIIIa?

The molecular formula of Aristolactam AIIIa is C16H11NO4.

What is the molecular weight of Aristolactam AIIIa?

The molecular weight of Aristolactam AIIIa is 281.26 g/mol.

What is the melting point of Aristolactam AIIIa?

The melting point of Aristolactam AIIIa is greater than 300°C.

In what solvents is Aristolactam AIIIa soluble?

Aristolactam AIIIa is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted boiling point of Aristolactam AIIIa?

The predicted boiling point of Aristolactam AIIIa is 521.1±50.0 °C.

What is the predicted pka value of Aristolactam AIIIa?

The predicted pka value of Aristolactam AIIIa is 8.63±0.20.

What is the color of Aristolactam AIIIa?

Aristolactam AIIIa is yellow in color.

What is the form of Aristolactam AIIIa?

Aristolactam AIIIa is in powder form.

What are the target proteins of Aristolactam AIIIa?

The target proteins of Aristolactam AIIIa are CDK and MAPK.

What is the PubChem ID of Aristolactam AIIIa?

The PubChem ID of Aristolactam AIIIa is 10356352.

※ Please kindly note that our products are for research use only.