Aristolactam BII

Catalog Number	ACM53948097
CAS Number	53948-09-7
Synonyms	Cepharanone B
Molecular Weight	279.29
InChI	InChI=1S/C17H13NO3/c1-20-13-8-11-14-12(18-17(11)19)7-9-5-3-4-6-10(9)15(14)16(13)21-2/h3-8H,1-2H3,(H,18,19)
InChI Key	YHQIYHDLBZXUON-UHFFFAOYSA-N
Melting Point	264-265 °C
Purity	95%+
Complexity	426
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	279.08954328
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	279.08954328
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	47.6 Ų

Custom Q&A

What is the chemical formula for aristololactam BII?

The chemical formula for aristololactam BII is C17H13NO3.

What is the molecular weight of aristololactam BII?

The molecular weight of aristololactam BII is 279.29 g/mol.

Which solvents is aristololactam BII soluble in?

Aristololactam BII is soluble in chloroform, dichloromethane, ethyl acetate, DMSO, acetone, etc.

What is the melting point of aristololactam BII?

The melting point of aristololactam BII is 264-265°C.

What is the predicted boiling point of aristololactam BII?

The predicted boiling point of aristololactam BII is 429.7±38.0°C.

How does aristololactam BII appear in its solid form?

Aristololactam BII appears as a powder with a yellow color.

Where can aristololactam BII be isolated from?

Aristololactam BII can be isolated from the callus tissue of Stephania cepharantha.

What kind of mass does aristololactam BII form when crystallized from EtOH?

Aristololactam BII forms a mass of pale yellow needles when crystallized from EtOH.

What are some of the absorption maxima in the ultraviolet spectrum of aristololactam BII in EtOH?

The ultraviolet spectrum of aristololactam BII in EtOH has absorption maxima at 232, 263, 276, 287, 319, and 396 nm.

For what targets is aristololactam BII used?

Aristololactam BII is used for NO and HIV as targets.

※ Please kindly note that our products are for research use only.