Aristolochic acid D

Catalog Number	ACM17413386-1
CAS Number	17413-38-6
Structure
Synonyms	Aristolochic acid Iva
IUPAC Name	10-Hydroxy-8-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid
Molecular Weight	357.27
Molecular Formula	C17H11NO8
Canonical SMILES	COC1=CC(=CC2=C3C(=C(C=C12)[N+](=O)[O-])C(=CC4=C3OCO4)C(=O)O)O
InChI	InChI=1S/C17H11NO8/c1-24-12-3-7(19)2-9-8(12)4-11(18(22)23)14-10(17(20)21)5-13-16(15(9)14)26-6-25-13/h2-5,19H,6H2,1H3,(H,20,21)
InChI Key	PADIFGYTAXNCRK-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	580
Exact Mass	357.04846631
Heavy Atom Count	26
Monoisotopic Mass	357.04846631
Topological Polar Surface Area	131Ų

Custom Q&A

What is the chemical formula for Aristolochic acid D?

The chemical formula for Aristolochic acid D is C17H11NO8.

What is the molecular weight of Aristolochic acid D?

The molecular weight of Aristolochic acid D is 357.27.

What are some synonyms for Aristolochic acid D?

Some synonyms for Aristolochic acid D are simply "Aristolochic acid D".

What is the usage of Aristolochic acid D?

Aristolochic acid D is a derivative of carcinogenic Aristolochic acids (AAs).

What is the significance of Aristolochic acid D being a derivative of carcinogenic Aristolochic acids?

It suggests that Aristolochic acid D may also have carcinogenic properties or effects.

Is Aristolochic acid D commonly used in the medical or pharmaceutical industry?

It is not if Aristolochic acid D is commonly used in the medical or pharmaceutical industry.

※ Please kindly note that our products are for research use only.