Aristolochic acid II

Catalog Number	ACM475809-2
CAS Number	475-80-9
Synonyms	Aristolochic acid B
IUPAC Name	6-Nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid
Molecular Weight	311.25
Molecular Formula	C16H9NO6
Canonical SMILES	C1OC2=C(O1)C3=C(C(=C2)C(=O)O)C(=CC4=CC=CC=C43)[N+](=O)[O-]
InChI	InChI=1S/C16H9NO6/c18-16(19)10-6-12-15(23-7-22-12)14-9-4-2-1-3-8(9)5-11(13(10)14)17(20)21/h1-6H,7H2,(H,18,19)
InChI Key	MEEXETVZNQYRSP-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	505
Exact Mass	311.04298701
Heavy Atom Count	23
Monoisotopic Mass	311.04298701
Topological Polar Surface Area	102Ų

Custom Q&A

What is the chemical formula of Aristolochic acid B?

The chemical formula of Aristolochic acid B is C16H9NO6.

What is the melting point of Aristolochic acid B?

The melting point of Aristolochic acid B is between 270-272°C.

What is the boiling point of Aristolochic acid B?

The predicted boiling point of Aristolochic acid B is 592.2±50.0 °C.

Is Aristolochic acid B soluble in water?

Aristolochic acid B is practically insoluble in water.

What are the potential exposures to Aristolochic acids?

Aristolochic acids are used primarily as a chemical intermediate for pharmaceuticals, lab chemicals, herbal extracts, and drugs.

How are Aristolochic acids classified in terms of carcinogenicity?

Aristolochic acids are known to be human carcinogens based on sufficient evidence of carcinogenicity from studies in humans and supporting data on mechanisms of carcinogenesis.

How should waste Aristolochic acid B be disposed of?

It is inappropriate and possibly dangerous to dispose of expired or waste Aristolochic acid B by flushing it down the toilet or discarding it in the trash. It should be carefully disposed of according to DEA, EPA, and FDA regulations.

What are some incompatibilities of Aristolochic acid B?

Carboxyl group compounds, when reacting with all bases, both inorganic and organic, release substantial heat, water, and a harmful salt. It is also incompatible with oxidizers and alkaline materials.

What is the Safety Information regarding Aristolochic acid B?

Aristolochic acid B is classified as RIDADR 2811, HazardClass 6.1(b), and PackingGroup III.

What is the usage of Aristolochic acid B?

Aristolochic acid B is one of a group of substituted 1-phenanthrenecarboxylic acids that occur in Aristolochiaceae plants and in butterflies feeding on these plants.

※ Please kindly note that our products are for research use only.