Bellidifolin

Catalog Number	ACM2798256-1
CAS Number	2798-25-6
Structure
Synonyms	Bellidifolium
IUPAC Name	1,5,8-Trihydroxy-3-methoxyxanthen-9-one
Molecular Weight	274.22
Molecular Formula	C14H10O6
Canonical SMILES	COC1=CC(=C2C(=C1)OC3=C(C=CC(=C3C2=O)O)O)O
InChI	InChI=1S/C14H10O6/c1-19-6-4-9(17)11-10(5-6)20-14-8(16)3-2-7(15)12(14)13(11)18/h2-5,15-17H,1H3
InChI Key	JDIORNFCMMYMLF-UHFFFAOYSA-N
Melting Point	270 °C
Purity	98%+(HPLC)
Appearance	Yellow powder
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	386
Exact Mass	274.04773803
Heavy Atom Count	20
Monoisotopic Mass	274.04773803
Topological Polar Surface Area	96.2Ų

Custom Q&A

What is the chemical name of bellidifolin?

The chemical name of bellidifolin is 1,5,8-Trihydroxy-3-methoxy-9H-xanthen-9-one.

What is the molecular formula of bellidifolin?

The molecular formula of bellidifolin is C14H10O6.

What is the molecular weight of bellidifolin?

The molecular weight of bellidifolin is 274.23 g/mol.

What is the melting point of bellidifolin?

The melting point of bellidifolin is 265-267℃.

Is bellidifolin soluble in DMSO?

Yes, bellidifolin is soluble in DMSO.

What is the pka value of bellidifolin?

The pka value of bellidifolin is 6.37±0.20.

What are some uses of bellidifolin?

Bellidifolin is defined as an important chemotaxonomic marker of the Swertia genus and exhibits hepatoprotective activities against carbon tetrachloride-induced cell damage.

In which plants is bellidifolin naturally found?

Bellidifolin is naturally found in Swertia chirata and Gentianella campestris.

What is the boiling point of bellidifolin?

The boiling point of bellidifolin is predicted to be 580.2±50.0 °C.

Why is bellidifolin considered a significant marker of the Swertia genus?

Bellidifolin is considered a significant marker of the Swertia genus due to its unique chemical structure and presence in certain plant species within the genus.

※ Please kindly note that our products are for research use only.