Brefeldin A

Catalog Number	ACM20350156-1
CAS Number	20350-15-6
Structure
Synonyms	Ascotoxin
IUPAC Name	(1R,2R,3E,7S,11E,13S,15S)-2,15-Dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one
Molecular Weight	280.36
Molecular Formula	C16H24O4
Canonical SMILES	CC1CCCC=CC2CC(CC2C(C=CC(=O)O1)O)O
InChI	InChI=1S/C16H24O4/c1-11-5-3-2-4-6-12-9-13(17)10-14(12)15(18)7-8-16(19)20-11/h4,6-8,11-15,17-18H,2-3,5,9-10H2,1H3/b6-4+,8-7+/t11-,12+,13-,14+,15+/m0/s1
InChI Key	KQNZDYYTLMIZCT-KQPMLPITSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	388
Exact Mass	280.16745924
Heavy Atom Count	20
Isomeric SMILES	C[C@H]1CCC/C=C/[C@@H]2C[C@@H](C[C@H]2[C@@H](/C=C/C(=O)O1)O)O
Monoisotopic Mass	280.16745924
Topological Polar Surface Area	66.8Ų

Custom Q&A

What is the chemical formula of Brefeldin A?

The chemical formula of Brefeldin A is C16H24O4.

What is the molecular weight of Brefeldin A?

The molecular weight of Brefeldin A is 280.36 g/mol.

What is the melting point of Brefeldin A?

The melting point of Brefeldin A is 200-205 °C.

How is Brefeldin A stored?

Brefeldin A should be sealed in dry conditions, stored in the freezer, and kept under -20°C.

What is the solubility of Brefeldin A in methanol?

Brefeldin A is soluble in methanol at 10 mg/mL, appearing clear, colorless to faintly yellow.

What are the safety hazard codes associated with Brefeldin A?

The safety hazard codes for Brefeldin A are Xn and T.

What is the main usage of Brefeldin A?

Brefeldin A is a specific inhibitor of protein translocation from the endoplasmic reticulum to the Golgi and induces apoptosis.

How does Brefeldin A affect vesicular transport in cells?

Brefeldin A interferes with protein trafficking and secretion mediated by the Golgi apparatus and endoplasmic reticulum.

What is the biological activity of Brefeldin A?

Brefeldin A is a reversible inhibitor of protein translocation from the endoplasmic reticulum to the Golgi apparatus.

How is Brefeldin A purified?

Brefeldin A can be isolated from Penicillium brefeldianum and recrystallised from aqueous MeOH/EtOAc or MeOH.

※ Please kindly note that our products are for research use only.