Calyciphylline A

Catalog Number	ACM596799303
CAS Number	596799-30-3
Molecular Weight	385.5
InChI	InChI=1S/C23H31NO4/c1-12-10-24(27)11-14-6-4-13-5-7-15-17(21(26)28-3)9-23(19(13)15)20(25)16(12)8-18(24)22(14,23)2/h12,14-18H,4-11H2,1-3H3/t12-,14-,15-,16-,17-,18-,22-,23+,24/m1/s1
InChI Key	DLTJWHRTAHFESH-IGJFRSLJSA-N
Purity	95%+
Complexity	835
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	8
Exact Mass	385.22530847
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@@H]1C[N+]2(C[C@H]3CCC4=C5[C@H](CC4)[C@@H](C[C@]56[C@]3([C@H]2C[C@H]1C6=O)C)C(=O)OC)[O-]
Monoisotopic Mass	385.22530847
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	61.4 Ų

Custom Q&A

What is the product name of Calyciphylline A?

The product name of Calyciphylline A is Calyciphylline A.

What are some synonyms of Calyciphylline A?

Some synonyms of Calyciphylline A are 1H-11,12c-Methanocyclopent[1,8]azuleno[4,5-a]indolizine-2-carboxylic acid, and methyl ester.

What is the CAS number of Calyciphylline A?

The CAS number of Calyciphylline A is 596799-30-3.

What is the molecular formula of Calyciphylline A?

The molecular formula of Calyciphylline A is C23H31NO4.

What is the molecular weight of Calyciphylline A?

The molecular weight of Calyciphylline A is 385.5.

In what forms is Calyciphylline A soluble?

Calyciphylline A is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What form does Calyciphylline A come in?

Calyciphylline A comes in powder form.

What is the predicted pka of Calyciphylline A?

The predicted pka of Calyciphylline A is 4.68±0.70.

Can you predict the solubility of Calyciphylline A in water based on the given information?

Based on the information provided, Calyciphylline A is not soluble in water.

※ Please kindly note that our products are for research use only.