Calystegine B4

Catalog Number	ACM184046853
CAS Number	184046-85-3
Structure
Synonyms	(1R,2S,3R,4R,5R)-8-Azabicyclo[3.2.1]octane-1,2,3,4-tetrol
Molecular Weight	175.18
InChI	InChI=1S/C7H13NO4/c9-4-3-1-2-7(12,8-3)6(11)5(4)10/h3-6,8-12H,1-2H2/t3-,4-,5-,6+,7-/m1/s1
InChI Key	FXFBVZOJVHCEDO-BNWJMWRWSA-N
Purity	95%+
Complexity	200
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	175.0844579
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	5
Isomeric SMILES	C1C[C@]2([C@H]([C@@H]([C@@H]([C@@H]1N2)O)O)O)O
Monoisotopic Mass	175.0844579
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	93 Ų

Custom Q&A

What is the pka value of Calystegine B4?

The pka value of Calystegine B4 is 13.45±0.70 (Predicted).

What are some synonyms for Calystegine B4?

Some synonyms for Calystegine B4 are (1R,2S,3R,4R,5R)-8-Azabicyclo[3.2.1]octane-1,2,3,4-tetrol and Calystegine B4 - 95% min.

What is the CAS number of Calystegine B4?

The CAS number of Calystegine B4 is 184046-85-3.

What is the molecular formula of Calystegine B4?

The molecular formula of Calystegine B4 is C7H13NO4.

What is the molecular weight of Calystegine B4?

The molecular weight of Calystegine B4 is 175.18.

What is the boiling point of Calystegine B4?

The boiling point of Calystegine B4 is 341.0±42.0 °C (Predicted).

What is the density of Calystegine B4?

The density of Calystegine B4 is 1.722±0.06 g/cm3 (Predicted).

※ Please kindly note that our products are for research use only.