Calystegine C2

Catalog Number	ACM190957449
CAS Number	190957-44-9
Molecular Weight	191.18
InChI	InChI=1S/C7H13NO5/c9-2-1-7(13)6(12)5(11)4(10)3(2)8-7/h2-6,8-13H,1H2/t2-,3-,4+,5-,6-,7-/m1/s1
InChI Key	GGOJRYWHKVYFQK-AGZHHQKVSA-N
Purity	95%+
Complexity	225
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	191.07937252
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	6
Isomeric SMILES	C1[C@H]([C@@H]2[C@@H]([C@H]([C@H]([C@]1(N2)O)O)O)O)O
Monoisotopic Mass	191.07937252
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	113 Ų

Custom Q&A

What is the chemical formula of Calystegine C2?

The chemical formula of Calystegine C2 is C7H13NO5.

What is the molecular weight of Calystegine C2?

The molecular weight of Calystegine C2 is 191.18.

What is the CAS number of Calystegine C2?

The CAS number of Calystegine C2 is 190957-44-9.

What are the synonyms of Calystegine C2?

The synonyms of Calystegine C2 are 8-Azabicyclo[3.2.1]octane-1,2,3,4,6-pentol and (1R,2R,3R,4S,5R,6R)-.

What is the predicted boiling point of Calystegine C2?

The predicted boiling point of Calystegine C2 is 425.1±45.0 °C.

What is the predicted density of Calystegine C2?

The predicted density of Calystegine C2 is 1.937±0.06 g/cm3.

What is the predicted pKa value of Calystegine C2?

The predicted pKa value of Calystegine C2 is 13.21±0.70.

How many oxygen atoms are present in the molecular formula of Calystegine C2?

There are five oxygen atoms present in the molecular formula of Calystegine C2.

What is the stereochemistry of Calystegine C2?

The stereochemistry of Calystegine C2 is (1R,2R,3R,4S,5R,6R).

※ Please kindly note that our products are for research use only.