Cannabisin P

Catalog Number	ACM2756983192
CAS Number	2756983-19-2
IUPAC Name	(1R,2S,3R,4S)-1-(3,4-Dihydroxyphenyl)-4,6,7-trihydroxy-2-N,3-N-bis[2-(4-hydroxyphenyl)ethyl]-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxamide
Molecular Weight	614.64
Molecular Formula	C34H34N2O9
Canonical SMILES	C1=CC(=CC=C1CCNC(=O)C2C(C(C3=CC(=C(C=C3C2C4=CC(=C(C=C4)O)O)O)O)O)C(=O)NCCC5=CC=C(C=C5)O)O
InChI	InChI=1S/C34H34N2O9/c37-21-6-1-18(2-7-21)11-13-35-33(44)30-29(20-5-10-25(39)26(40)15-20)23-16-27(41)28(42)17-24(23)32(43)31(30)34(45)36-14-12-19-3-8-22(38)9-4-19/h1-10,15-17,29-32,37-43H,11-14H2,(H,35,44)(H,36,45)/t29-,30+,31-,32-/m1/s1
InChI Key	MBNIRPJOKBPXPI-VWPRMMSESA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	969
Exact Mass	614.22643067
Heavy Atom Count	45
Isomeric SMILES	C1=CC(=CC=C1CCNC(=O)[C@@H]2[C@H]([C@@H](C3=CC(=C(C=C3[C@H]2C4=CC(=C(C=C4)O)O)O)O)O)C(=O)NCCC5=CC=C(C=C5)O)O
Monoisotopic Mass	614.22643067
Topological Polar Surface Area	200Ų

Custom Q&A

What is the product name of Cannabisin P?

The product name of Cannabisin P is Cannabisin P.

What are the synonyms for Cannabisin P?

There are no listed synonyms for Cannabisin P.

What is the CAS number for Cannabisin P?

The CAS number for Cannabisin P is 2756983-19-2.

What is the molecular formula of Cannabisin P?

The molecular formula of Cannabisin P is C34H34N2O9.

What is the molecular weight of Cannabisin P?

The molecular weight of Cannabisin P is 614.65.

What is the predicted boiling point of Cannabisin P?

The predicted boiling point of Cannabisin P is 1054.4±65.0 °C.

What is the predicted density of Cannabisin P?

The predicted density of Cannabisin P is 1.454±0.06 g/cm3.

What is the predicted pka value of Cannabisin P?

The predicted pka value of Cannabisin P is 9.72±0.10.

※ Please kindly note that our products are for research use only.