Carmichaenine B

Catalog Number	ACM2065228604
CAS Number	2065228-60-4
Molecular Weight	439.5
InChI	InChI=1S/C23H37NO7/c1-4-24-9-20(10-25)6-5-13(26)23-18(20)16(31-3)14(19(23)24)21(28)8-12(30-2)11-7-22(23,29)17(21)15(11)27/h11-19,25-29H,4-10H2,1-3H3/t11-,12+,13+,14?,15+,16+,17-,18-,19-,20+,21+,22+,23-/m1/s1
InChI Key	IVNCQHJFFGCDLK-PCHVQWGKSA-N
Purity	95%+
Complexity	783
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	12
Exact Mass	439.25700252
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	5
Isomeric SMILES	CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2[C@H](C([C@H]31)[C@]5(C[C@@H]([C@H]6C[C@@]4([C@@H]5[C@H]6O)O)OC)O)OC)O)CO
Monoisotopic Mass	439.25700252
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	123 Ų

Custom Q&A

What is the chemical formula of Carmichaenine B?

The chemical formula of Carmichaenine B is C23H37NO7.

What is the molecular weight of Carmichaenine B?

The molecular weight of Carmichaenine B is 439.55.

What is the CAS number of Carmichaenine B?

The CAS number of Carmichaenine B is 2065228-60-4.

What are the synonyms of Carmichaenine B?

The synonyms of Carmichaenine B are Aconitane-1,8,10,14-tetrol, 20-ethyl-4-(hydroxymethyl)-6,16-dimethoxy-, (1α,6α,14α,16β)-

What is the predicted boiling point of Carmichaenine B?

The predicted boiling point of Carmichaenine B is 629.0±55.0 °C.

What is the predicted density of Carmichaenine B?

The predicted density of Carmichaenine B is 1.43±0.1 g/cm3.

What is the pka value of Carmichaenine B?

The pka value of Carmichaenine B is 12.88±0.70.

※ Please kindly note that our products are for research use only.