Carmichaenine C

Catalog Number	ACM2065228615
CAS Number	2065228-61-5
Molecular Weight	527.6
InChI	InChI=1S/C30H41NO7/c1-4-31-14-28(15-36-2)11-10-20(32)30-18-12-17-19(37-3)13-29(35,22(26(30)31)23(33)25(28)30)21(18)24(17)38-27(34)16-8-6-5-7-9-16/h5-9,17-26,32-33,35H,4,10-15H2,1-3H3/t17-,18-,19+,20+,21-,22,23+,24+,25-,26-,28+,29-,30+/m1/s1
InChI Key	DQTNVONSIQDYGN-APBCSOOVSA-N
Purity	95%+
Complexity	957
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	12
Exact Mass	527.28830265
Heavy Atom Count	38
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	3
Isomeric SMILES	CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2[C@H](C([C@H]31)[C@]5(C[C@@H]([C@H]6C[C@@H]4[C@@H]5[C@H]6OC(=O)C7=CC=CC=C7)OC)O)O)O)COC
Monoisotopic Mass	527.28830265
PhysicalState	Powder
Rotatable Bond Count	7
Topological Polar Surface Area	109 Ų

Custom Q&A

What is the product name of Carmichaenine C?

The product name of Carmichaenine C is Carmichaenine C.

What are some synonyms for Carmichaenine C?

Some synonyms for Carmichaenine C are Aconitane-1,6,8,14-tetrol, 20-ethyl-16-methoxy-4-(methoxymethyl)-, 14-benzoate.

What is the CAS number of Carmichaenine C?

The CAS number of Carmichaenine C is 2065228-61-5.

What is the molecular formula of Carmichaenine C?

The molecular formula of Carmichaenine C is C30H41NO7.

What is the molecular weight of Carmichaenine C?

The molecular weight of Carmichaenine C is 527.66.

What is the predicted boiling point of Carmichaenine C?

The predicted boiling point of Carmichaenine C is 670.0±55.0 °C.

What is the predicted density of Carmichaenine C?

The predicted density of Carmichaenine C is 1.35±0.1 g/cm3.

What is the predicted pka value of Carmichaenine C?

The predicted pka value of Carmichaenine C is 13.11±0.70.

What are some physical properties of Carmichaenine C?

Some physical properties of Carmichaenine C include boiling point, density, and pka value.

Why is it important to know the chemical properties of Carmichaenine C?

It is important to know the chemical properties of Carmichaenine C for various applications in research, synthesis, and testing.

※ Please kindly note that our products are for research use only.