Cephaeline dihydrobromide

Catalog Number	ACM6014819-1
CAS Number	6014-81-9
Synonyms	Desmethylemetine dihydrobromide
IUPAC Name	(1R)-1-[[(2S,3R,11bS)-3-Ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl]-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol;dihydrobromide
Molecular Weight	628.4
Molecular Formula	C28H40Br2N2O4
Canonical SMILES	CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)O)OC)OC)OC.Br.Br
InChI	InChI=1S/C28H38N2O4.2BrH/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23;;/h12-15,17,20,23-24,29,31H,5-11,16H2,1-4H3;2*1H/t17-,20-,23+,24-;;/m0../s1
InChI Key	LBEHXAAQCILFGO-JBKGYMEJSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	664
Exact Mass	628.13343
Heavy Atom Count	36
Isomeric SMILES	CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)O)OC)OC)OC.Br.Br
Monoisotopic Mass	628.13343
Topological Polar Surface Area	63.2Ų

Custom Q&A

What is the product name for Cephaeline dihydrobromide?

The product name is MINIMALE LIEFERMENGE.

What are some synonyms for Cephaeline dihydrobromide?

Some synonyms for Cephaeline dihydrobromide are Cephaelin dihydrobroMid and CEPHAELINE DIHYDROBROMIDE.

What is the chemical formula for Cephaeline dihydrobromide?

The chemical formula is C28H40Br2N2O4.

What is the molecular weight of Cephaeline dihydrobromide?

The molecular weight is 628.4362.

What is the CAS number for Cephaeline dihydrobromide?

The CAS number is 6014-81-9.

What is the stereochemistry of Cephaeline dihydrobromide?

It is (1R)-1-[[(2S,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl]-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol.

What are the main functional groups present in Cephaeline dihydrobromide?

The main functional groups are an alcohol group, an ether group, and a bromide group.

How many carbon atoms are present in the chemical structure of Cephaeline dihydrobromide?

There are 28 carbon atoms in the structure.

What is the significance of the dihydrobromide salt form of Cephaeline?

The dihydrobromide salt form of Cephaeline is commonly used for pharmaceutical purposes due to its stability and solubility properties.

※ Please kindly note that our products are for research use only.