Chysin A

Catalog Number	ACM22269110
CAS Number	22269-11-0
Structure
Synonyms	(4R,5R)-1-Azabicyclo[3.3.0]octane-4-carboxylic acid methyl ester
Molecular Weight	169.22
InChI	InChI=1S/C9H15NO2/c1-12-9(11)7-4-6-10-5-2-3-8(7)10/h7-8H,2-6H2,1H3/t7-,8-/m1/s1
InChI Key	CFWZLIYRMYFCIH-HTQZYQBOSA-N
Purity	95%+
Complexity	193
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	169.110278721
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	COC(=O)[C@@H]1CCN2[C@@H]1CCC2
Monoisotopic Mass	169.110278721
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the chemical name of Chysin A?

The chemical name is (4R,5R)-1-Azabicyclo[3.3.0]octane-4-carboxylic acid methyl ester.

What are the synonyms for Chysin A?

The synonyms are Chysin, Chysine, Chysin A, and 1H-Pyrrolizine-1-carboxylic acid, hexahydro-, methyl ester, (1R,7aR)-.

What is the molecular formula of (4R,5R)-1-Azabicyclo[3.3.0]octane-4-carboxylic acid methyl ester?

The molecular formula is C9H15NO2.

What is the molecular weight of Chysin A?

The molecular weight is 169.22 g/mol.

What is the boiling point of (4R,5R)-1-Azabicyclo[3.3.0]octane-4-carboxylic acid methyl ester?

The boiling point is 60 °C at a pressure of 0.5 Torr.

What is the density of Chysin A?

The density is 1.11 ± 0.1 g/cm3.

What is the predicted pKa value for (4R,5R)-1-Azabicyclo[3.3.0]octane-4-carboxylic acid methyl ester?

The predicted pKa value is 9.70 ± 0.40.

How is (4R,5R)-1-Azabicyclo[3.3.0]octane-4-carboxylic acid methyl ester commonly referred to as?

It is commonly referred to as Chysin.

What is the name given to the methyl ester form of (4R,5R)-1-Azabicyclo[3.3.0]octane-4-carboxylic acid?

The methyl ester form is known as (4R,5R)-1-Azabicyclo[3.3.0]octane-4-carboxylic acid methyl ester.

※ Please kindly note that our products are for research use only.