Coptisine chloride

Coptisine chloride

Inquiry
Catalog Number ACM6020184-1
CAS Number 6020-18-4
Description Coptisine chloride is a natural compound that has been shown to have significant cytotoxicity against cancer cells. Coptisine chloride inhibits the mitochondrial membrane potential and induces apoptosis in myeloma cells. It also inhibits the production of proinflammatory cytokines, such as tumor necrosis factor-α, IL-1β, and IL-6, in activated macrophages. Coptisine chloride also has an inhibitory effect on toll-like receptor 4 (TLR4), which is important for the development of inflammatory responses. The structure of coptisine chloride was determined by molecular docking analysis and it was found to bind to ATP synthase. In addition, coptisite chloride inhibited polymerase chain reaction (PCR) amplification of DNA templates in vitro. This compound can be used as a lead compound for the development of novel anti-inflammatory drugs.
Synonyms 6,7-Dihydrobis[1,3]benzodioxolo[5,6-a:4',5'-g]quinolizinium chloride
Molecular Weight 355.77 g/mol
Molecular Formula C19H14ClNO4
Canonical SMILES C1C[N+]2=C(C=C3C=CC4=C(C3=C2)OCO4)C5=CC6=C(C=C51)OCO6.[Cl-]
Storage store at 2℃-8℃
MDL Number MFCD00016676
Custom Q&A

What is the molecular formula of Coptisine chloride?

The molecular formula of Coptisine chloride is C19H14ClNO4.

What is the melting point of Coptisine chloride?

The melting point of Coptisine chloride is above 258°C (dec.).

In what type of atmosphere should Coptisine chloride be stored?

Coptisine chloride should be stored in an inert atmosphere at 2-8°C.

What is the solubility of Coptisine chloride in DMSO?

Coptisine chloride is slightly soluble in DMSO.

What is a potential use of Coptisine chloride?

Coptisine is an alkaloid found in Chinese goldthread and has been found to reversibly inhibit Monoamine oxidase A in mice, suggesting a potential role as a natural antidepressant.

What is the color of Coptisine chloride?

Coptisine chloride is orange to dark orange in color.

What is a potential role of Coptisine chloride as?

Coptisine chloride is mentioned to be a bacterial collagenase inhibitor.

What is the molecular weight of Coptisine chloride?

The molecular weight of Coptisine chloride is 355.77 g/mol.

What are some of the product categories that Coptisine chloride falls under?

Coptisine chloride falls under pharmaceutical intermediate, phytochemical, Amines, chemical reagent, and reference standards from Chinese medicinal herbs (TCM).

What is the stability of Coptisine chloride?

Coptisine chloride is hygroscopic in nature.

※ Please kindly note that our products are for research use only.