Cotarnine

Catalog Number	ACM82542-1
CAS Number	82-54-2
Description	Cotarnine is a drug that belongs to the class of hydrogen bonding interactions. It has been shown to be effective against a number of infectious diseases, including inflammatory bowel disease and infectious diarrhea. Cotarnine is an analog for penicillin and binds to bacterial cell walls, inhibiting enzymes that are necessary for protein synthesis. It also forms hydrogen bonds with the hydroxyl group on the surface of cells, which may be responsible for its ability to form a film-forming polymer in vitro.
Synonyms	5, 6, 7, 8- Tetrahydro- 4- methoxy- 6- methyl-1, 3- Dioxolo[4, 5- g] isoquinolin- 5- ol
Molecular Weight	237.25 g/mol
Molecular Formula	C12H15NO4
Canonical SMILES	CN1CCC2=CC3=C(C(=C2C1O)OC)OCO3
Storage	store at 10℃-25℃, keep under inert gas: Nitrogen
Harmonized Tariff Code	Switzerland: 29062990 - USA: 2906296000 - Slovakia: 2906290090 - UK: 2906290000 - China: 2906299090

Custom Q&A

What is the molecular formula of Cotarnine?

The molecular formula of Cotarnine is C12H15NO4.

What is the melting point of Cotarnine?

The melting point of Cotarnine is greater than 110°C.

How should Cotarnine be stored?

Cotarnine should be stored in a hygroscopic, -20°C freezer, under an inert atmosphere.

In what forms is Cotarnine soluble?

Cotarnine is slightly soluble in chloroform and methanol.

What is the color of Cotarnine?

Cotarnine is light yellow to yellow in color.

What is the stability of Cotarnine?

Cotarnine is hygroscopic.

What is the usage of Cotarnine?

Cotarnine is an intermediate in synthesizing Cotarnine Chloride, an oxidative degradation product of the drug Noscapine.

What is Cotarnine Chloride?

Cotarnine Chloride is synthesized using Cotarnine and is an oxidative degradation product of the drug Noscapine.

What are some properties of Cotarnine?

Some properties of Cotarnine include being hygroscopic, having a melting point greater than 110°C, and being slightly soluble in chloroform and methanol.

How can Cotarnine be used in the synthesis of other compounds?

Cotarnine can be used as an intermediate in the synthesis of Cotarnine Chloride, which is an important compound in the degradation process of the drug Noscapine.

※ Please kindly note that our products are for research use only.