Cyclanoline

Catalog Number	ACM18556279-1
CAS Number	18556-27-9
Synonyms	Cissamine
IUPAC Name	(7S,13aS)-3,10-Dimethoxy-7-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-2,9-diol
Molecular Weight	342.41
Molecular Formula	C20H24NO4+
Canonical SMILES	C[N+]12CCC3=CC(=C(C=C3C1CC4=C(C2)C(=C(C=C4)OC)O)O)OC
InChI	InChI=1S/C20H23NO4/c1-21-7-6-13-9-19(25-3)17(22)10-14(13)16(21)8-12-4-5-18(24-2)20(23)15(12)11-21/h4-5,9-10,16H,6-8,11H2,1-3H3,(H-,22,23)/p+1/t16-,21-/m0/s1
InChI Key	LKLWVKCEYSPQHL-KKSFZXQISA-O
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	488
Exact Mass	342.17053325
Heavy Atom Count	25
Isomeric SMILES	C[N@@+]12CCC3=CC(=C(C=C3[C@@H]1CC4=C(C2)C(=C(C=C4)OC)O)O)OC
Monoisotopic Mass	342.17053325
Topological Polar Surface Area	58.9Ų

Custom Q&A

What is the chemical formula of cyclanoline?

The chemical formula of cyclanoline is C20H24NO4+.

What are some synonyms of cyclanoline?

Some synonyms of cyclanoline include 6H-Dibenzo[a,g]quinolizinium, 5,8,13,13a-tetrahydro-, Ciclanoline, and (-)-Cyclanolin.

What is the CAS number of cyclanoline?

The CAS number of cyclanoline is 18556-27-9.

What is the molecular weight of cyclanoline?

The molecular weight of cyclanoline is 342.41 g/mol.

How is cyclanoline classified in ChEBI?

Cyclanoline is classified in ChEBI as a charged berberine alkaloid obtained by N-methylation of (S)-scoulerine.

What is the basic structure of cyclanoline?

The basic structure of cyclanoline is 6H-Dibenzo[a,g]quinolizinium, 5,8,13,13a-tetrahydro-.

How is cyclanoline typically used in synthesis?

Cyclanoline is typically used in chemical synthesis processes due to its unique structure and properties.

What is the stereochemistry of cyclanoline?

The stereochemistry of cyclanoline is specified as (7S,13aS).

※ Please kindly note that our products are for research use only.