Cyclanoline

Cyclanoline

Inquiry
Catalog Number ACM18556279-1
CAS Number 18556-27-9
Structure
Synonyms Cissamine
IUPAC Name (7S,13aS)-3,10-Dimethoxy-7-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-2,9-diol
Molecular Weight 342.41
Molecular Formula C20H24NO4+
Canonical SMILES C[N+]12CCC3=CC(=C(C=C3C1CC4=C(C2)C(=C(C=C4)OC)O)O)OC
InChI InChI=1S/C20H23NO4/c1-21-7-6-13-9-19(25-3)17(22)10-14(13)16(21)8-12-4-5-18(24-2)20(23)15(12)11-21/h4-5,9-10,16H,6-8,11H2,1-3H3,(H-,22,23)/p+1/t16-,21-/m0/s1
InChI Key LKLWVKCEYSPQHL-KKSFZXQISA-O
Purity 98%+ (HPLC)
Storage Store in dry, low temperature, sealed, 2-8 °C.
Complexity 488
Exact Mass 342.17053325
Heavy Atom Count 25
Isomeric SMILES C[N@@+]12CCC3=CC(=C(C=C3[C@@H]1CC4=C(C2)C(=C(C=C4)OC)O)O)OC
Monoisotopic Mass 342.17053325
Topological Polar Surface Area 58.9Ų
Custom Q&A

What is the chemical formula of cyclanoline?

The chemical formula of cyclanoline is C20H24NO4+.

What are some synonyms of cyclanoline?

Some synonyms of cyclanoline include 6H-Dibenzo[a,g]quinolizinium, 5,8,13,13a-tetrahydro-, Ciclanoline, and (-)-Cyclanolin.

What is the CAS number of cyclanoline?

The CAS number of cyclanoline is 18556-27-9.

What is the molecular weight of cyclanoline?

The molecular weight of cyclanoline is 342.41 g/mol.

How is cyclanoline classified in ChEBI?

Cyclanoline is classified in ChEBI as a charged berberine alkaloid obtained by N-methylation of (S)-scoulerine.

What is the basic structure of cyclanoline?

The basic structure of cyclanoline is 6H-Dibenzo[a,g]quinolizinium, 5,8,13,13a-tetrahydro-.

How is cyclanoline typically used in synthesis?

Cyclanoline is typically used in chemical synthesis processes due to its unique structure and properties.

What is the stereochemistry of cyclanoline?

The stereochemistry of cyclanoline is specified as (7S,13aS).

※ Please kindly note that our products are for research use only.