Cyclanoline chloride

Cyclanoline chloride

Inquiry
Catalog Number ACM17472503
CAS Number 17472-50-3
Structure
Description Cyclanoline chloride is a diphenyl ether that inhibits the activity of the enzyme dehydrotrametenolic acid, which is involved in the biosynthesis of the stephania alkaloids. It also has potential as an antidiabetic agent, as it can inhibit sugar uptake by pancreatic cells and has been shown to reduce blood sugar levels in diabetic animals. Cyclanoline chloride also inhibits protein synthesis and acts as a cytotoxic agent, inhibiting the growth of cancer cells. This drug is converted to methylated derivatives by cytochrome P450 enzymes and may be metabolized through hydrolysis or dechlorination reactions with glutathione reductase or other reductases.
Molecular Weight 377.86 g/mol
Molecular Formula C20H24ClNO4
Canonical SMILES C[N+]12CCC3=CC(=C(C=C3C1CC4=C(C2)C(=C(C=C4)OC)O)O)OC.[Cl-]
Storage store at 2℃-8℃
Harmonized Tariff Code Switzerland: 29339980 - USA: 2933997900 - Slovakia: 2933998090 - UK: 2933998090 - China: 2933990099
MDL Number MFCD00221739
Custom Q&A

What is the chemical formula for Cyclanoline chloride?

The chemical formula for Cyclanoline chloride is C20H24ClNO4.

What is the molecular weight of Cyclanoline chloride?

The molecular weight of Cyclanoline chloride is 377.86.

What are the synonyms for Cyclanoline chloride?

The synonyms for Cyclanoline chloride are the same as its product name.

What is the molecular structure of Cyclanoline chloride?

The molecular structure of Cyclanoline chloride includes carbon, hydrogen, chlorine, nitrogen, and oxygen atoms.

What is the common use of Cyclanoline chloride?

Cyclanoline chloride is commonly used in the synthesis of various organic compounds.

Is Cyclanoline chloride a naturally occurring compound?

Cyclanoline chloride is not a naturally occurring compound and is typically synthesized in a laboratory setting.

How is Cyclanoline chloride typically produced?

Cyclanoline chloride is typically produced through a series of chemical reactions involving specific precursors.

What is the significance of the chloride in Cyclanoline chloride?

The chloride in Cyclanoline chloride may play a role in its chemical properties, reactivity, or applications.

Are there any known health or safety risks associated with Cyclanoline chloride?

Information on the health or safety risks associated with Cyclanoline chloride may vary, and it is recommended to handle this compound with proper care and precautions.

※ Please kindly note that our products are for research use only.