Cyclo(-Leu-Pro)

Catalog Number	ACM2873361
CAS Number	2873-36-1
Structure
Synonyms	(3S-Trans)-hexahydro-3-isobutylpyrrolo[1,2-a]pyrazine-1,4-dione
Molecular Weight	210.27
InChI	InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14)/t8-,9-/m0/s1
InChI Key	SZJNCZMRZAUNQT-IUCAKERBSA-N
Melting Point	163-165 °C
Purity	95%+
Complexity	288
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	210.136827821
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC(C)C[C@H]1C(=O)N2CCC[C@H]2C(=O)N1
Monoisotopic Mass	210.136827821
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	49.4 Ų

Custom Q&A

What is the chemical formula of CYCLO(-LEU-PRO)?

The chemical formula of CYCLO(-LEU-PRO) is C11H18N2O2.

What is the molecular weight of CYCLO(-LEU-PRO)?

The molecular weight of CYCLO(-LEU-PRO) is 210.27 g/mol.

What is the melting point of CYCLO(-LEU-PRO)?

The melting point of CYCLO(-LEU-PRO) is 163-165°C.

What is the predicted boiling point of CYCLO(-LEU-PRO)?

The predicted boiling point of CYCLO(-LEU-PRO) is 427.6±34.0 °C.

In what type of atmosphere should CYCLO(-LEU-PRO) be stored?

CYCLO(-LEU-PRO) should be stored in an inert atmosphere at 2-8°C.

What is the solubility of CYCLO(-LEU-PRO) in chloroform, ethanol, and methanol?

CYCLO(-LEU-PRO) is slightly soluble in chloroform, ethanol, and methanol.

What is the predicted pka value of CYCLO(-LEU-PRO)?

The predicted pka value of CYCLO(-LEU-PRO) is 13.27±0.40.

What is the toxicity of CYCLO(-LEU-PRO in mice?

The LD50 of CYCLO(-LEU-PRO) in mice is 80mg/kg when administered intravenously.

What is the primary usage of CYCLO(-LEU-PRO)?

CYCLO(-LEU-PRO) is a diketopiperazine metabolite with antibacterial and antifouling activities.

What are the chemical properties of CYCLO(-LEU-PRO)?

CYCLO(-LEU-PRO) is a white solid with a density of 1.14.

※ Please kindly note that our products are for research use only.