Cyclobuxine D

Catalog Number	ACM2241909-1
CAS Number	2241-90-9
Structure
Description	Cyclobuxine D is a cyclobuxosuffrine alkaloid that can be found in the etoac extract. It was isolated from the heart of frogs, and has been shown to have anti-HIV activity. Cyclobuxine D inhibits HIV by binding to the viral protease enzyme and preventing it from cleaving specific proteins required for HIV replication. It also has a number of other biological activities, including anti-inflammatory effects, cardiotonic effects, and antibacterial effects. Cyclobuxine D is synthesized by plants as a natural drug that binds to human steroid receptors. The compound contains a hydroxyl group and is an example of a steroidal alkaloid. This drug can be prepared by high-performance liquid chromatography (HPLC) and is used in biochemistry research for its ability to inhibit creatine kinase.
Molecular Weight	386.61 g/mol
Molecular Formula	C25H42N2O
Canonical SMILES	C[C@@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5=C)NC)C)C)O)NC
Storage	store at 2℃-8℃, close container well
Harmonized Tariff Code	Switzerland: 29398000 - USA: 2939800000 - Slovakia: 2939800000 - UK: 2939800000 - China: 2939800000
MDL Number	MFCD01745535

Custom Q&A

What is the chemical formula of Cyclovirobuxin D?

The chemical formula of Cyclovirobuxin D is C26H46N2O.

What is the melting point of Cyclovirobuxin D?

The melting point of Cyclovirobuxin D is 220-221 °C.

What is the boiling point of Cyclovirobuxin D estimated to be?

The boiling point of Cyclovirobuxin D is estimated to be 524.75°C.

What is the molecular weight of Cyclovirobuxin D?

The molecular weight of Cyclovirobuxin D is 402.66 g/mol.

How is Cyclovirobuxin D stored?

Cyclovirobuxin D should be stored at -20°C.

What is the usage of Cyclovirobuxin D?

Cyclovirobuxin D is used as a potential preventative agent of cardiac dysfunction.

What are the pharmacological effects of Cyclovirobuxin D on the heart?

Cyclovirobuxin D has a positive inotropic effect on the heart due to the inhibition of cardiomyocyte membrane Na+-K+-ATPase activity.

How does Cyclovirobuxin D affect myocardial oxygen consumption?

Cyclovirobuxin D can markedly reduce myocardial oxygen consumption and increase coronary blood flow.

How does Cyclovirobuxin D protect against acute cerebral ischemia?

Cyclovirobuxin D can cross the blood-brain barrier, improve brain microcirculation, and oxygen supply to treat cerebral arteriosclerosis insufficiency.

What are some examples of salts and derivatives of Cyclovirobuxin D?

Some examples include the dihydrobromide, dihydriodide, diperchlorate, dioxalate, N:Ndiacetyl derivative, and O,N,N-triacetyl derivative of Cyclovirobuxin D.

※ Please kindly note that our products are for research use only.