De(hydroxymethyl)voachalotinol

Catalog Number	ACM2912110
CAS Number	2912-11-0
Structure
Synonyms	1-Methylsarpagan-17-ol
Molecular Weight	308.4
InChI	InChI=1S/C20H24N2O/c1-3-12-10-22-18-9-15-13-6-4-5-7-17(13)21(2)20(15)19(22)8-14(12)16(18)11-23/h3-7,14,16,18-19,23H,8-11H2,1-2H3/b12-3-/t14-,16+,18-,19-/m0/s1
InChI Key	UVWQYWHKTZABSO-ILADVTTDSA-N
Purity	95%+
Complexity	518
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	308.188863393
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C\1/CN2[C@H]3C[C@@H]1[C@H]([C@@H]2CC4=C3N(C5=CC=CC=C45)C)CO
Monoisotopic Mass	308.188863393
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	28.4 Ų

Custom Q&A

What is the predicted pka value of De(hydroxymethyl)voachalotinol?

The predicted pka value of De(hydroxymethyl)voachalotinol is 14.77±0.10.

What are some synonyms for De(hydroxymethyl)voachalotinol?

Some synonyms for De(hydroxymethyl)voachalotinol are 1-Methylsarpagan-17-ol, Affinisine, and (+)-Affinisine.

What is the CAS number for De(hydroxymethyl)voachalotinol?

The CAS number for De(hydroxymethyl)voachalotinol is 2912-11-0.

What is the molecular formula of De(hydroxymethyl)voachalotinol?

The molecular formula of De(hydroxymethyl)voachalotinol is C20H24N2O.

What is the molecular weight of De(hydroxymethyl)voachalotinol?

The molecular weight of De(hydroxymethyl)voachalotinol is 308.423.

What is the melting point of De(hydroxymethyl)voachalotinol?

The melting point of De(hydroxymethyl)voachalotinol is 1924 °C.

In wat solvents is De(hydroxymethyl)voachalotinol soluble?

De(hydroxymethyl)voachalotinol is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What form does De(hydroxymethyl)voachalotinol come in?

De(hydroxymethyl)voachalotinol comes in powder form.

What is the predicted boiling point of De(hydroxymethyl)voachalotinol?

The predicted boiling point of De(hydroxymethyl)voachalotinol is 475.4±45.0 °C.

※ Please kindly note that our products are for research use only.