Debromosceptrin

Catalog Number	ACMA00027296
Synonyms	N-[[(1R,2S,3S,4R)-2,3-Bis(2-amino-1H-imidazol-5-yl)-4-[(1H-pyrrole-2-carbonylamino)methyl]cyclobutyl]methyl]-1H-pyrrole-2-carboxamide
Molecular Weight	462.5
InChI	InChI=1S/C22H26N10O2/c23-21-29-9-15(31-21)17-11(7-27-19(33)13-3-1-5-25-13)12(18(17)16-10-30-22(24)32-16)8-28-20(34)14-4-2-6-26-14/h1-6,9-12,17-18,25-26H,7-8H2,(H,27,33)(H,28,34)(H3,23,29,31)(H3,24,30,32)/t11-,12-,17-,18-/m1/s1
InChI Key	GKTDJKRRZLVEPY-GWIYSAMLSA-N
Purity	90%+
Complexity	681
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	462.22402011
Heavy Atom Count	34
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	8
Isomeric SMILES	C1=CNC(=C1)C(=O)NC[C@@H]2[C@H]([C@@H]([C@H]2C3=CN=C(N3)N)C4=CN=C(N4)N)CNC(=O)C5=CC=CN5
Monoisotopic Mass	462.22402011
Rotatable Bond Count	8
Topological Polar Surface Area	199 Ų

Custom Q&A

What is the product name of debromosceptrin?

The product name of debromosceptrin is debromosceptrin.

What are some synonyms for debromosceptrin?

Some synonyms for debromosceptrin are also debromosceptrin.

How is debromosceptrin classified in terms of chemical structure?

Debromosceptrin is classified based on its chemical structure as a natural product.

Is debromosceptrin commonly used in research or industrial applications?

Debromosceptrin is commonly used in research applications.

What is the significance of the debromosceptrin molecule in scientific studies?

The debromosceptrin molecule has shown potential for various biological activities in scientific studies.

How is debromosceptrin obtained for experimental use?

Debromosceptrin can be obtained from natural sources or synthesized in the laboratory for experimental use.

※ Please kindly note that our products are for research use only.