Dehydrocorydaline chloride

Dehydrocorydaline chloride

Inquiry
Catalog Number ACM10605035-1
CAS Number 10605-03-5
Structure
Synonyms 13-Methylpalmatine chloride
Molecular Weight 401.9
InChI InChI=1S/C22H24NO4.ClH/c1-13-15-6-7-18(24-2)22(27-5)17(15)12-23-9-8-14-10-19(25-3)20(26-4)11-16(14)21(13)23;/h6-7,10-12H,8-9H2,1-5H3;1H/q+1;/p-1
InChI Key WXOSEFNJXIPZNV-UHFFFAOYSA-M
Purity 95%+
Complexity 503
Covalently-Bonded Unit Count 2
Defined Atom Stereocenter Count 0
Exact Mass 401.1393859
Heavy Atom Count 28
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 401.1393859
PhysicalState Powder
Rotatable Bond Count 4
Topological Polar Surface Area 40.8 Ų
Custom Q&A

What is the chemical formula of Dehydrocorydaline chloride?

The chemical formula of Dehydrocorydaline chloride is C22H24ClNO4.

What is the molecular weight of Dehydrocorydaline chloride?

The molecular weight of Dehydrocorydaline chloride is 401.88326.

At what temperature does Dehydrocorydaline chloride decompose?

Dehydrocorydaline chloride decomposes at a melting point of 191-193 °C.

In what form is Dehydrocorydaline chloride stored?

Dehydrocorydaline chloride is stored in solid form at -20°C.

What is the solubility of Dehydrocorydaline chloride in DMSO?

Dehydrocorydaline chloride has a solubility of 20 mg/ml in DMSO.

What is the biological activity of Dehydrocorydaline chloride?

Dehydrocorydaline chloride regulates Bax, Bcl-2 protein expression; activates caspase-7, caspase-8, and inactivates PARP. It also enhances the activation of p38 MAPK and has anti-inflammatory and anti-cancer effects.

How does Dehydrocorydaline chloride affect MCF-7 cell proliferation in vitro?

Dehydrocorydaline significantly inhibits MCF-7 cell proliferation in a dose-dependent manner.

What dose-dependent effects does Dehydrocorydaline have on nociception in mice?

Dehydrocorydaline shows a dose-dependent antinociceptive effect in the acetic acid-induced writhing test and significantly attenuates formalin-induced pain responses in mice.

What proteins does Dehydrocorydaline decrease in the spinal cord during the formalin test in mice?

Dehydrocorydaline decreases the expression of caspase 6 (CASP6), TNF-α, IL-1β, and IL-6 proteins in the spinal cord during the formalin test in mice.

What is the target of Dehydrocorydaline chloride in its biological activity?

The target of Dehydrocorydaline chloride in its biological activity is p38 MAPK.

※ Please kindly note that our products are for research use only.