Dehydrocrenatidine

Catalog Number	ACM65236626
CAS Number	65236-62-6
Synonyms	1-Ethenyl-4,8-dimethoxy-9H-pyrido[3,4-b]indole
Molecular Weight	254.28
InChI	InChI=1S/C15H14N2O2/c1-4-10-15-13(12(19-3)8-16-10)9-6-5-7-11(18-2)14(9)17-15/h4-8,17H,1H2,2-3H3
InChI Key	LDWBTKDUAXOZRB-UHFFFAOYSA-N
Purity	95%+
Complexity	336
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	254.105527694
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	254.105527694
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	47.1 Ų

Custom Q&A

What is the product name of the compound with the CAS number 65236-62-6?

The product name is Dehydrocrenatidine

What are some synonyms for Dehydrocrenatidine?

Some synonyms include 1-ethenyl-4,8-dimethoxy-9H-pyrido[3,4-b]indole and TOP-3

What is the molecular formula of Dehydrocrenatidine?

The molecular formula is C15H14N2O2

What is the molecular weight of Dehydrocrenatidine?

The molecular weight is 254.28

How many carbon, hydrogen, nitrogen, and oxygen atoms are present in the molecular formula of Dehydrocrenatidine?

There are 15 carbon atoms, 14 hydrogen atoms, 2 nitrogen atoms, and 2 oxygen atoms in the molecular formula.

What functional groups are present in the chemical structure of Dehydrocrenatidine?

The chemical structure contains methoxy groups and an ethenyl group.

What is the chemical classification of Dehydrocrenatidine?

Dehydrocrenatidine is classified as a pyridoindole compound.

※ Please kindly note that our products are for research use only.