Dehydroglaucine

Dehydroglaucine

Inquiry
Catalog Number ACM22212266
CAS Number 22212-26-6
Structure
Synonyms 6a,7-Didehydroglaucine
Molecular Weight 353.4
InChI InChI=1S/C21H23NO4/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20/h8-11H,6-7H2,1-5H3
InChI Key RZUHGAKUNBFQJS-UHFFFAOYSA-N
Melting Point 131-133 °C
Purity 95%+
Complexity 489
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 353.16270821
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 353.16270821
PhysicalState Powder
Rotatable Bond Count 4
Topological Polar Surface Area 40.2 Ų
Custom Q&A

What is the chemical formula of Dehydroglaucine?

The chemical formula of Dehydroglaucine is C21H23NO4.

What is the molecular weight of Dehydroglaucine?

The molecular weight of Dehydroglaucine is 353.41.

What is the melting point of Dehydroglaucine?

The melting point of Dehydroglaucine is 131-133℃ in methanol.

In which solvents is Dehydroglaucine soluble?

Dehydroglaucine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of Dehydroglaucine?

Dehydroglaucine is in crystalline form.

What is the predicted pka value of Dehydroglaucine?

The predicted pka value of Dehydroglaucine is 3.26±0.20.

What is the boiling point of Dehydroglaucine?

The predicted boiling point of Dehydroglaucine is 539.9±50.0 °C.

What is the target use of Dehydroglaucine in terms of its usage and synthesis?

The target use of Dehydroglaucine is antifection.

How many synonyms are there for Dehydroglaucine?

There are four synonyms listed for Dehydroglaucine, including "6a,7-Didehydroglaucine", "Didehydroglaucine", "Dehdroglaucine", and "5,6-Dihydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinoline".

What is the density of Dehydroglaucine at 20 ºC and 760 Torr?

The density of Dehydroglaucine is 1.202±0.06 g/cm3 at 20 ºC and 760 Torr.

※ Please kindly note that our products are for research use only.