Dehydropipernonaline

Catalog Number	ACM107584383
CAS Number	107584-38-3
Structure
Synonyms	Dehydropipernoline
IUPAC Name	(2E,4E,8E)-9-(1,3-Benzodioxol-5-yl)-1-piperidin-1-ylnona-2,4,8-trien-1-one
Molecular Weight	339.43
Molecular Formula	C21H25NO3
Canonical SMILES	C1CCN(CC1)C(=O)C=CC=CCCC=CC2=CC3=C(C=C2)OCO3
InChI	InChI=1S/C21H25NO3/c23-21(22-14-8-5-9-15-22)11-7-4-2-1-3-6-10-18-12-13-19-20(16-18)25-17-24-19/h2,4,6-7,10-13,16H,1,3,5,8-9,14-15,17H2/b4-2+,10-6+,11-7+
InChI Key	KAYVDASZRFLFRZ-PQECNABGSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	505
Exact Mass	339.18344366
Heavy Atom Count	25
Isomeric SMILES	C1CCN(CC1)C(=O)/C=C/C=C/CC/C=C/C2=CC3=C(C=C2)OCO3
Monoisotopic Mass	339.18344366
Topological Polar Surface Area	38.8Ų

Custom Q&A

What is the product name of dehydropipernonaline?

The product name of dehydropipernonaline is dehydropipernonaline.

What are some synonyms for dehydropipernonaline?

Some synonyms for dehydropipernonaline are Piperonal Impurity 12.

What is the CAS number for dehydropipernonaline?

The CAS number for dehydropipernonaline is 107584-38-3.

What is the molecular formula of dehydropipernonaline?

The molecular formula of dehydropipernonaline is C21H25NO3.

What is the molecular weight of dehydropipernonaline?

The molecular weight of dehydropipernonaline is 339.4281.

According to ChEBI, what category does dehydropipernonaline belong to?

According to ChEBI, dehydropipernonaline is a member of benzodioxoles.

What is the usage of dehydropipernonaline?

The usage of dehydropipernonaline is not explicitly.

How is dehydropipernonaline different from piperonal?

Dehydropipernonaline is a different compound from piperonal, as it is referred to as an impurity of piperonal.

What is the significance of dehydropipernonaline in the field of chemistry?

The significance of dehydropipernonaline in the field of chemistry may lie in its potential as a member of benzodioxoles, but further research and information are needed to determine its exact role.

※ Please kindly note that our products are for research use only.