Dehyrocaridine

Dehyrocaridine

Inquiry
Catalog Number ACM83218342
CAS Number 83218-34-2
Synonyms Hexadehydrocavidine
Molecular Weight 348.4
InChI InChI=1S/C21H18NO4/c1-12-14-4-5-17-21(26-11-25-17)16(14)10-22-7-6-13-8-18(23-2)19(24-3)9-15(13)20(12)22/h4-10H,11H2,1-3H3/q+1
InChI Key TWSZDJCOYVYRGM-UHFFFAOYSA-N
Purity 95%+
Complexity 516
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 348.12358306
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 0
Monoisotopic Mass 348.12358306
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 41 Ų
Custom Q&A

What is the chemical formula of Dehydrocavidine?

The chemical formula of Dehydrocavidine is C21H18NO4+.

What is the molecular weight of Dehydrocavidine?

The molecular weight of Dehydrocavidine is 348.38.

What are some synonyms of Dehydrocavidine?

Some synonyms of Dehydrocavidine include Hexadehydrocavidine and Hexadehydrothalictrifoline.

In which products is Dehydrocavidine soluble?

Dehydrocavidine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of Dehydrocavidine?

Dehydrocavidine is in the form of a powder.

Where is Dehydrocavidine found naturally?

Dehydrocavidine is an alkaloid found in Corydalis saxicola.

What potential activity does Dehydrocavidine display?

Dehydrocavidine displays potential anti-hepatitis B activity.

What targets does Dehydrocavidine affect in the body?

Dehydrocavidine targets Bcl-2/Bax, Caspase, IL Receptor, PARP, cAMP, and PGE.

What is the CAS number of Dehydrocavidine?

The CAS number of Dehydrocavidine is 83218-34-2.

What are some other names for Dehydrocavidine?

Another name for Dehydrocavidine is Benzo[a]-1,3-benzodioxolo[4,5-g]quinolizin-13-ium,8,9-dimethoxy-6-methyl-.

※ Please kindly note that our products are for research use only.