Demethylcephalotaxinone

Demethylcephalotaxinone

Inquiry
Catalog Number ACM51020452
CAS Number 51020-45-2
Synonyms (S)-1-Hydroxy-5,6,8,9-tetrahydro-4H-[1,3]dioxolo[4',5':4,5]benzo[1,2-d]cyclopenta[b]pyrrolo[1,2-a]azepin-2(3H)-one
Molecular Weight 299.32
InChI InChI=1S/C17H17NO4/c19-12-8-17-3-1-4-18(17)5-2-10-6-13-14(22-9-21-13)7-11(10)15(17)16(12)20/h6-7,20H,1-5,8-9H2
InChI Key FDWVASNYLQYPMN-UHFFFAOYSA-N
Purity 95%+
Complexity 559
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 299.11575802
Heavy Atom Count 22
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 1
Monoisotopic Mass 299.11575802
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 59 Ų
Custom Q&A

What is the chemical formula of Demethylcephalotaxinone?

The chemical formula of Demethylcephalotaxinone is C17H17NO4.

What is the molecular weight of Demethylcephalotaxinone?

The molecular weight of Demethylcephalotaxinone is 299.33 g/mol.

What is the boiling point of Demethylcephalotaxinone?

The boiling point of Demethylcephalotaxinone is predicted to be 517.8±50.0 °C.

What is the density of Demethylcephalotaxinone?

The density of Demethylcephalotaxinone is predicted to be 1.49±0.1 g/cm3.

What is the pKa value of Demethylcephalotaxinone?

The pKa value of Demethylcephalotaxinone is predicted to be 8.92±0.20.

What is Demethylcephalotaxinone primarily isolated from?

Demethylcephalotaxinone is a minor constituent of the alkaloidal mixture obtained from Cephalotaxus fortuni.

How is the structure of Demethylcephalotaxinone established?

The structure of Demethylcephalotaxinone is established chemically and spectroscopically, and confirmed by synthesis.

In what year was Demethylcephalotaxinone's structure confirmed by synthesis?

The structure of Demethylcephalotaxinone was confirmed by synthesis in 1975.

What is a synonym for Demethylcephalotaxinone?

A synonym for Demethylcephalotaxinone is Cephalotaxine, 3,4-didehydro-2-demethoxy-1,2-dihydro-2-oxo-, (5S)-;(S)-1-hydroxy-5,6,8,9-tetrahydro-4H-[1,3]dioxolo[4',5':4,5]benzo[1,2-d]cyclopenta[b]pyrrolo[1,2-a]azepin-2(3H)-one.

What is the CAS number of Demethylcephalotaxinone?

The CAS number of Demethylcephalotaxinone is 51020-45-2.

※ Please kindly note that our products are for research use only.