Deoxybouvardin

Deoxybouvardin

Inquiry
Catalog Number ACM64725242
CAS Number 64725-24-2
Molecular Weight 756.8
InChI InChI=1S/C40H48N6O9/c1-22-35(48)42-23(2)38(51)44(4)30(18-25-8-13-28(54-7)14-9-25)37(50)43-24(3)39(52)46(6)32-19-26-10-15-29(16-11-26)55-34-21-27(12-17-33(34)47)20-31(36(49)41-22)45(5)40(32)53/h8-17,21-24,30-32,47H,18-20H2,1-7H3,(H,41,49)(H,42,48)(H,43,50)
InChI Key VXVGFMUNENQGFW-UHFFFAOYSA-N
Purity 95%+
Complexity 1400
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 756.34827713
Heavy Atom Count 55
Hydrogen Bond Acceptor Count 9
Hydrogen Bond Donor Count 4
Monoisotopic Mass 756.34827713
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 187 Ų
Custom Q&A

What is the product name of the chemical compound with synonyms AIDS-032100, RA V, and Deoxybouvardin?

The product name of the chemical compound is AIDS-032100.

What is the molecular formula of Deoxybouvardin?

The molecular formula of Deoxybouvardin is C40H48N6O9.

What is the molecular weight of Deoxybouvardin?

The molecular weight of Deoxybouvardin is 756.86.

What is the CAS number of Deoxybouvardin?

The CAS number of Deoxybouvardin is 64725-24-2.

What is the predicted boiling point of Deoxybouvardin?

The predicted boiling point of Deoxybouvardin is 1083.3±65.0 °C.

What is the predicted density of Deoxybouvardin?

The predicted density of Deoxybouvardin is 1.189±0.06 g/cm3.

What is the predicted pKa value of Deoxybouvardin?

The predicted pKa value of Deoxybouvardin is 9.11±0.70.

What is the synonym for Deoxybouvardin that is a cyclic ether compound?

The synonym for Deoxybouvardin that is a cyclic ether compound is Cyclo(D-alanyl-L-alanyl-N,O-dimethyl-L-tyrosyl-L-alanyl-N-methyl-L-tyrosyl-3-hydroxy-N-methyl-L-tyrosyl), cyclic (5→63)-ether.

How many nitrogen atoms are present in the molecular formula of Deoxybouvardin?

There are six nitrogen atoms present in the molecular formula of Deoxybouvardin.

What is the chemical property of Deoxybouvardin that is important for predicting its behavior in certain reactions?

The pKa value of Deoxybouvardin, predicted to be 9.11±0.70, is important for predicting its behavior in certain reactions.

※ Please kindly note that our products are for research use only.