- Home
- Products
- Other Alkaloids
- Deoxycalyciphylline B
- Home
- About Us
- Products
- Services
- Markets
- Order Center
- Contact Us
Catalog Number | ACM619326748 |
CAS Number | 619326-74-8 |
Molecular Weight | 341.5 |
InChI | InChI=1S/C22H31NO2/c1-13-12-23-19-16-5-3-4-14(16)6-7-17(19)21(2)22(11-9-18(24)25-21)10-8-15(13)20(22)23/h5,13-15,17,19-20H,3-4,6-12H2,1-2H3 |
InChI Key | NGQSEZXJVMCXSC-UHFFFAOYSA-N |
Melting Point | 182 °C |
Purity | 95%+ |
Complexity | 671 |
Covalently-Bonded Unit Count | 1 |
Defined Atom Stereocenter Count | 0 |
Exact Mass | 341.235479232 |
Heavy Atom Count | 25 |
Hydrogen Bond Acceptor Count | 3 |
Hydrogen Bond Donor Count | 0 |
Monoisotopic Mass | 341.235479232 |
PhysicalState | Powder |
Rotatable Bond Count | 0 |
Topological Polar Surface Area | 29.5 Ų |
What is the chemical formula for Deoxycalyciphylline B?
The chemical formula for Deoxycalyciphylline B is C22H31NO2.
What is the molecular weight of Deoxycalyciphylline B?
The molecular weight of Deoxycalyciphylline B is 341.5 g/mol.
What is the melting point of Deoxycalyciphylline B?
The melting point of Deoxycalyciphylline B is 182°C (decomposition).
What is the predicted boiling point of Deoxycalyciphylline B?
The predicted boiling point of Deoxycalyciphylline B is 502.3±50.0°C.
What is the predicted density of Deoxycalyciphylline B?
The predicted density of Deoxycalyciphylline B is 1.20±0.1 g/cm3.
What is the predicted pKa value of Deoxycalyciphylline B?
The predicted pKa value of Deoxycalyciphylline B is 9.03±0.60.
What are some synonyms for Deoxycalyciphylline B?
Some synonyms for Deoxycalyciphylline B include 7H-Cyclopent[hi]indeno[4,5-e]pyrano[2,3-g]indolizin-7-one and (2S,2aR,4aS,8aR,8bS,10aR,13bR,14aS)-.
What is the CAS number for Deoxycalyciphylline B?
The CAS number for Deoxycalyciphylline B is 619326-74-8.
What is the full name of the compound Deoxycalyciphylline B?
The full name of Deoxycalyciphylline B is 7H-Cyclopent[hi]indeno[4,5-e]pyrano[2,3-g]indolizin-7-one, 1,2,2a,3,4,5,6,8a,8b,9,10,10a,11,12,13b,14a-hexadecahydro-2,8a-dimethyl-, (2S,2aR,4aS,8aR,8bS,10aR,13bR,14aS)-.
How many Carbon, Hydrogen, Nitrogen, and Oxygen atoms are in the molecular formula of Deoxycalyciphylline B?
The molecular formula of Deoxycalyciphylline B contains 22 Carbon atoms, 31 Hydrogen atoms, 1 Nitrogen atom, and 2 Oxygen atoms.
※ Please kindly note that our products are for research use only.
Privacy Policy | Cookie Policy | Copyright © 2025 Alfa Chemistry. All rights reserved.