Deoxycalyciphylline B

Deoxycalyciphylline B

Inquiry
Catalog Number ACM619326748
CAS Number 619326-74-8
Molecular Weight 341.5
InChI InChI=1S/C22H31NO2/c1-13-12-23-19-16-5-3-4-14(16)6-7-17(19)21(2)22(11-9-18(24)25-21)10-8-15(13)20(22)23/h5,13-15,17,19-20H,3-4,6-12H2,1-2H3
InChI Key NGQSEZXJVMCXSC-UHFFFAOYSA-N
Melting Point 182 °C
Purity 95%+
Complexity 671
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 341.235479232
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 0
Monoisotopic Mass 341.235479232
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 29.5 Ų
Custom Q&A

What is the chemical formula for Deoxycalyciphylline B?

The chemical formula for Deoxycalyciphylline B is C22H31NO2.

What is the molecular weight of Deoxycalyciphylline B?

The molecular weight of Deoxycalyciphylline B is 341.5 g/mol.

What is the melting point of Deoxycalyciphylline B?

The melting point of Deoxycalyciphylline B is 182°C (decomposition).

What is the predicted boiling point of Deoxycalyciphylline B?

The predicted boiling point of Deoxycalyciphylline B is 502.3±50.0°C.

What is the predicted density of Deoxycalyciphylline B?

The predicted density of Deoxycalyciphylline B is 1.20±0.1 g/cm3.

What is the predicted pKa value of Deoxycalyciphylline B?

The predicted pKa value of Deoxycalyciphylline B is 9.03±0.60.

What are some synonyms for Deoxycalyciphylline B?

Some synonyms for Deoxycalyciphylline B include 7H-Cyclopent[hi]indeno[4,5-e]pyrano[2,3-g]indolizin-7-one and (2S,2aR,4aS,8aR,8bS,10aR,13bR,14aS)-.

What is the CAS number for Deoxycalyciphylline B?

The CAS number for Deoxycalyciphylline B is 619326-74-8.

What is the full name of the compound Deoxycalyciphylline B?

The full name of Deoxycalyciphylline B is 7H-Cyclopent[hi]indeno[4,5-e]pyrano[2,3-g]indolizin-7-one, 1,2,2a,3,4,5,6,8a,8b,9,10,10a,11,12,13b,14a-hexadecahydro-2,8a-dimethyl-, (2S,2aR,4aS,8aR,8bS,10aR,13bR,14aS)-.

How many Carbon, Hydrogen, Nitrogen, and Oxygen atoms are in the molecular formula of Deoxycalyciphylline B?

The molecular formula of Deoxycalyciphylline B contains 22 Carbon atoms, 31 Hydrogen atoms, 1 Nitrogen atom, and 2 Oxygen atoms.

※ Please kindly note that our products are for research use only.