Dihydrocapsaicin

Catalog Number	ACM19408845-3
CAS Number	19408-84-5
Structure
Synonyms	6,7-Dihydrocapsaicin
IUPAC Name	N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methylnonanamide
Molecular Weight	307.43
Molecular Formula	C18H29NO3
Canonical SMILES	CC(C)CCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC
InChI	InChI=1S/C18H29NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h10-12,14,20H,4-9,13H2,1-3H3,(H,19,21)
InChI Key	XJQPQKLURWNAAH-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	307
Exact Mass	307.21474379
Heavy Atom Count	22
Monoisotopic Mass	307.21474379
Topological Polar Surface Area	58.6Ų

Custom Q&A

What is the molecular formula of dihydrocapsaicin?

The molecular formula of dihydrocapsaicin is C18H29NO3.

What is the boiling point of dihydrocapsaicin?

The boiling point of dihydrocapsaicin is predicted to be 497.4±35.0 °C.

What is the color and physical form of dihydrocapsaicin?

Dihydrocapsaicin is a white to off-white solid.

What is the InChIKey of dihydrocapsaicin?

The InChIKey of dihydrocapsaicin is XJQPQKLURWNAAH-UHFFFAOYSA-N.

How is dihydrocapsaicin typically stored?

Dihydrocapsaicin is typically sealed in dry, 2-8°C storage conditions.

What are some safety hazard codes associated with dihydrocapsaicin?

The hazard codes associated with dihydrocapsaicin include T (Toxic) and various risk statements.

What are some common uses of dihydrocapsaicin?

Dihydrocapsaicin has been used as a reference standard in the identification of blood and tissue samples, as well as in tomato-based salsas.

What biological activities has dihydrocapsaicin been found to have?

Dihydrocapsaicin has been found to be active against various microorganisms and to have antioxidant properties.

How does dihydrocapsaicin affect autophagy and reactive oxygen species production?

Dihydrocapsaicin can increase autophagy marker LC3-II and reduce reactive oxygen species production in certain lung cells.

What is the main receptor that dihydrocapsaicin acts as an agonist for?

Dihydrocapsaicin acts as an agonist for the transient receptor potential vanilloid 1 (TRPV1) receptor.

※ Please kindly note that our products are for research use only.