Dihydrolycorine

Catalog Number	ACM6271212-1
CAS Number	6271-21-2
IUPAC Name	(1S,15R,17S,18S,19R)-5,7-Dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-triene-17,18-diol
Molecular Weight	289.33
Molecular Formula	C16H19NO4
Canonical SMILES	C1CN2CC3=CC4=C(C=C3C5C2C1CC(C5O)O)OCO4
InChI	InChI=1S/C16H19NO4/c18-11-3-8-1-2-17-6-9-4-12-13(21-7-20-12)5-10(9)14(15(8)17)16(11)19/h4-5,8,11,14-16,18-19H,1-3,6-7H2/t8-,11+,14+,15-,16-/m1/s1
InChI Key	VJILFEGOWCJNIK-MGRBZGILSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	433
Exact Mass	289.13140809
Heavy Atom Count	21
Isomeric SMILES	C1CN2CC3=CC4=C(C=C3[C@H]5[C@H]2[C@H]1C[C@@H]([C@H]5O)O)OCO4
Monoisotopic Mass	289.13140809
Topological Polar Surface Area	62.2Ų

Custom Q&A

What is the product name of the compound?

The product name of the compound is Dihydrolycorine.

What is Dihydrolycorine a derivative of?

Dihydrolycorine is a derivative of Lycorine, which is the main phenanthridine Amaryllidaceae alkaloid.

What is the main characteristic of Lycorine in terms of its activity?

Lycorine exhibits significant antitumor activity in cancer cells that display resistance to proapoptotic stimuli.

What is the molecular weight of Dihydrolycorine?

The molecular weight of Dihydrolycorine is not.

What are some potential uses of Dihydrolycorine?

Dihydrolycorine may be used for its antitumor activity in cancer cells.

What is the relationship between Dihydrolycorine and Lycorine?

Dihydrolycorine is a derivative of Lycorine.

What family of alkaloids does Dihydrolycorine belong to?

Dihydrolycorine belongs to the phenanthridine Amaryllidaceae alkaloid family.

Is Dihydrolycorine a natural or synthetic compound?

Dihydrolycorine is a derivative of a natural compound, Lycorine.

What type of activity does Dihydrolycorine exhibit in cancer cells?

Dihydrolycorine exhibits significant antitumor activity in cancer cells that display resistance to proapoptotic stimuli.

※ Please kindly note that our products are for research use only.