Enniatin B

Catalog Number	ACM917135
CAS Number	917-13-5
IUPAC Name	(3S,6R,9S,12R,15S,18R)-4,10,16-Trimethyl-3,6,9,12,15,18-hexa(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
Molecular Weight	639.82
Molecular Formula	C33H57N3O9
Canonical SMILES	CC(C)C1C(=O)OC(C(=O)N(C(C(=O)OC(C(=O)N(C(C(=O)OC(C(=O)N1C)C(C)C)C(C)C)C)C(C)C)C(C)C)C)C(C)C
InChI	InChI=1S/C33H57N3O9/c1-16(2)22-31(40)43-26(20(9)10)29(38)35(14)24(18(5)6)33(42)45-27(21(11)12)30(39)36(15)23(17(3)4)32(41)44-25(19(7)8)28(37)34(22)13/h16-27H,1-
InChI Key	MIZMDSVSLSIMSC-VYLWARHZSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	952
Exact Mass	639.40948040
Heavy Atom Count	45
Isomeric SMILES	CC(C)[C@H]1C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N1C)C(C)C)C(C)C)C)C(C)C)C(C)C)C)C(C)C
Monoisotopic Mass	639.40948040
Topological Polar Surface Area	140Ų

Custom Q&A

What is the chemical formula of Enniatin B?

The chemical formula of Enniatin B is C33H57N3O9.

What is the molecular weight of Enniatin B?

The molecular weight of Enniatin B is 639.83.

What is the solubility of Enniatin B in DMSO?

Enniatin B is soluble in DMSO at 10mg/mL.

What is the storage temperature recommended for Enniatin B?

The storage temperature recommended for Enniatin B is -20°C.

What are the risk statements associated with Enniatin B?

The risk statements associated with Enniatin B are 23/24/25.

What is the main usage of Enniatin B?

Enniatin B is used as an antibiotic.

How does Enniatin B function biochemically and physiologically?

Enniatin B functions as an ionophore antibiotic, affecting oxidative phosphorylation uncoupling.

What are the biological activities of Enniatin B?

Enniatin B is reported to have antibiotic, ionophoric, and in-vitro hypolipidemic activities.

What was observed after oral administration of Enniatin B to mice?

After oral administration to mice, no toxicological signs or pathological changes were observed.

What are some of the references mentioned regarding the effects and functions of Enniatin B?

Some references mentioned include studies on the inhibition of the Pdr5p transporter in Saccharomyces cerevisiae and the electrophysiological properties of Enniatin B.

※ Please kindly note that our products are for research use only.