Erucifolin N-oxide

Catalog Number	ACM123864948
CAS Number	123864-94-8
Synonyms	Erucifoline N-oxide
IUPAC Name	(5R,9Z,12R,18R)-9-Ethylidene-7-(hydroxymethyl)-5-methyl-15-oxido-3,6,11-trioxa-15-azoniatetracyclo[10.5.1.05,7.015,18]octadec-1(17)-ene-4,10-dione
Molecular Weight	365.38
Molecular Formula	C18H23NO7
Canonical SMILES	CC=C1CC2(C(O2)(C(=O)OCC3=CC[N+]4(C3C(CC4)OC1=O)[O-])C)CO
InChI	InChI=1S/C18H23NO7/c1-3-11-8-18(10-20)17(2,26-18)16(22)24-9-12-4-6-19(23)7-5-13(14(12)19)25-15(11)21/h3-4,13-14,20H,5-10H2,1-2H3/b11-3-/t13-,14-,17+,18?,19?/m1/s1
InChI Key	IJAULDQGSBFPPG-WZILVZQPSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	731
Exact Mass	365.14745207
Heavy Atom Count	26
Isomeric SMILES	C/C=C\1/CC2([C@@](O2)(C(=O)OCC3=CC[N+]4([C@H]3[C@@H](CC4)OC1=O)[O-])C)CO
Monoisotopic Mass	365.14745207
Topological Polar Surface Area	103Ų

Custom Q&A

What is the chemical formula of Erucifoline n-Oxide?

The chemical formula of Erucifoline n-Oxide is C18H23NO7.

What is the molecular weight of Erucifoline n-Oxide?

The molecular weight of Erucifoline n-Oxide is 365.38 g/mol.

How is Erucifoline n-Oxide predicted to have a pka value of?

Erucifoline n-Oxide is predicted to have a pka value of 14.57±0.10.

What is the CAS number for Erucifoline n-Oxide?

The CAS number for Erucifoline n-Oxide is 123864-94-8.

What is the source of Erucifoline n-Oxide?

Erucifoline n-Oxide is a toxic pyrrolizidine alkaloid isolated from Senecio Persoonii.

What are the synonyms for Erucifoline n-Oxide?

The synonyms for Erucifoline n-Oxide are ERUCIFOLINE N-OXIDE and Senecionan-11,16-dione, 12,13-epoxy-19-hydroxy-, 4-oxide.

What are the basic information details for Erucifoline n-Oxide?

The basic information details for Erucifoline n-Oxide include its CAS number, chemical formula, molecular weight, and synonyms.

What is the structure of Erucifoline n-Oxide predicted to be?

The structure of Erucifoline n-Oxide is predicted to contain a pyrrolizidine alkaloid.

How is Erucifoline n-Oxide used in research or industry?

Erucifoline n-Oxide is typically used in research related to toxic alkaloids and plant compounds.

What are some potential hazards associated with handling Erucifoline n-Oxide?

Erucifoline n-Oxide is a toxic compound and should be handled with caution to avoid exposure.

※ Please kindly note that our products are for research use only.