Erythrartine

Catalog Number	ACM51666263
CAS Number	51666-26-3
Synonyms	(3α,11β)-3,15,16-Trimethoxy-1,2,6,7-tetradehydroerythrinan-11-ol
Molecular Weight	329.4
InChI	InChI=1S/C19H23NO4/c1-22-13-5-4-12-6-7-20-11-16(21)14-8-17(23-2)18(24-3)9-15(14)19(12,20)10-13/h4-6,8-9,13,16,21H,7,10-11H2,1-3H3/t13-,16-,19-/m0/s1
InChI Key	QWWCVLZNFFVFTR-AXHNFQJDSA-N
Purity	95%+
Complexity	548
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	329.16270821
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CO[C@@H]1C[C@@]23C(=CCN2C[C@@H](C4=CC(=C(C=C34)OC)OC)O)C=C1
Monoisotopic Mass	329.16270821
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	51.2 Ų

Custom Q&A

What is the boiling point of Erythrartine?

The boiling point of Erythrartine is predicted to be 524.7±50.0 °C.

What is the density of Erythrartine?

The density of Erythrartine is predicted to be 1.28±0.1 g/cm3.

What is the pka value of Erythrartine?

The pka value of Erythrartine is predicted to be 13.53±0.40.

What is the molecular formula of Erythrartine?

The molecular formula of Erythrartine is C19H23NO4.

What are some synonyms of Erythrartine?

Some synonyms of Erythrartine are 1H-Indolo[7a,1-a]isoquinolin-9-ol, 2,6,8,9-tetrahydro-2,11,12-trimethoxy-, (2R,9R,13bS)- and (3α,11β)-3,15,16-Trimethoxy-1,2,6,7-tetradehydroerythrinan-11-ol.

What is the molecular weight of Erythrartine?

The molecular weight of Erythrartine is 329.39.

How is Erythrartine used in synthesis?

Erythrartine is a minor constituent of the alkaloidal extract of Erythrina variegata flowers.

What is the CAS number of Erythrartine?

The CAS number of Erythrartine is 51666-26-3.

What is the predicted boiling point of Erythrartine?

The predicted boiling point of Erythrartine is 524.7 ± 50.0 °C.

Where is Erythrartine found?

Erythrartine is found as a minor constituent in the alkaloidal extract of Erythrina variegata flowers.

※ Please kindly note that our products are for research use only.