Erythristemine

Catalog Number	ACM28619412
CAS Number	28619-41-2
Structure
Synonyms	1,2,6,7-Tetradehydro-3β,11α,15,16-tetramethoxyerythrinan
Molecular Weight	343.4
InChI	InChI=1S/C20H25NO4/c1-22-14-6-5-13-7-8-21-12-19(25-4)15-9-17(23-2)18(24-3)10-16(15)20(13,21)11-14/h5-7,9-10,14,19H,8,11-12H2,1-4H3/t14-,19-,20-/m0/s1
InChI Key	IUMRZRWBQPPMSS-GKCIPKSASA-N
Purity	95%+
Complexity	562
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	343.17835828
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	CO[C@@H]1C[C@@]23C(=CCN2C[C@@H](C4=CC(=C(C=C34)OC)OC)OC)C=C1
Monoisotopic Mass	343.17835828
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	40.2 Ų

Custom Q&A

What is the molecular formula of (+)-Erythristemine?

The molecular formula of (+)-Erythristemine is C20H25NO4.

What is the molecular weight of (+)-Erythristemine?

The molecular weight of (+)-Erythristemine is 343.42 g/mol.

What are some synonyms for (+)-Erythristemine?

Some synonyms for (+)-Erythristemine include 1,2,6,7-Tetradehydro-3β,11α,15,16-tetramethoxyerythrinan and (10bS)-6α,8,9,12β-Tetramethoxy-1,10b-[1]buteno-3,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline.

What is the CAS number for (+)-Erythristemine?

The CAS number for (+)-Erythristemine is 28619-41-2.

What is the boiling point of (+)-Erythristemine?

The predicted boiling point of (+)-Erythristemine is 494.9±45.0 °C.

What is the predicted density of (+)-Erythristemine?

The predicted density of (+)-Erythristemine is 1.22±0.1 g/cm3.

What is the pKa value of (+)-Erythristemine?

The predicted pKa value of (+)-Erythristemine is 4.55±0.60.

What is the chemical structure of (+)-Erythristemine?

The chemical structure of (+)-Erythristemine is a pyrrolo[2,1-a]isoquinoline with four methoxy groups on the molecule.

What is the IUPAC name for (+)-Erythristemine?

The IUPAC name for (+)-Erythristemine is (10bS)-6α,8,9,12β-Tetramethoxy-1,10b-[1]buteno-3,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline.

How is (+)-Erythristemine classified based on its chemical properties?

(+)-Erythristemine is classified as a tetramethoxyerythrinan compound.

※ Please kindly note that our products are for research use only.