Etofylline

Catalog Number	ACM519379-1
CAS Number	519-37-9
Structure
Synonyms	7-(2-Hydroxyethyl)theophylline
Molecular Weight	224.22
InChI	InChI=1S/C9H12N4O3/c1-11-7-6(8(15)12(2)9(11)16)13(3-4-14)5-10-7/h5,14H,3-4H2,1-2H3
InChI Key	NWPRCRWQMGIBOT-UHFFFAOYSA-N
Melting Point	163 °C
Purity	98%+
Complexity	322
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	224.09094026
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	224.09094026
PhysicalState	Solid
Rotatable Bond Count	2
Topological Polar Surface Area	78.7 Ų

Custom Q&A

What is the chemical formula of 7-(2-HYDROXYETHYL)THEOPHYLLINE?

The chemical formula of Etofylline is C9H12N4O3.

What is the molecular weight of Etofylline?

The molecular weight of Etofylline is 224.22.

What is the solubility of Etofylline in water?

Etofylline is soluble in water.

What are some synonyms of Etofylline?

Some synonyms of Etofylline are EPE(CRM STANDARD), MM(CRM STANDARD), Phyllocormin, and BIOPHYLLINE.

What is the melting point of Etofylline?

The melting point of Etofylline is 163°C.

What is the boiling point of Etofylline?

The boiling point of Etofylline is approximately 365.61°C.

What are the hazard codes associated with Etofylline?

The hazard codes for Etofylline are Xn and Xi.

What are some safety statements associated with Etofylline?

Safety statements for Etofylline include 36-36/37-26.

What is the therapeutic function of Etofylline?

Etofylline is used as an antihyperlipidemic.

How is Etofylline used in the pharmaceutical industry?

Etofylline is used as an inhibitor of 3',5'-Cyclic Nucleotide Phosphodiesterase and has diuretic, muscle relaxant, bronchial dilation, and CNS stimulant activities.

※ Please kindly note that our products are for research use only.