Evolitrine

Evolitrine

Inquiry
Catalog Number ACM523660
CAS Number 523-66-0
Structure
Synonyms 4,7-Dimethoxyfuro[2,3-b]quinoline
Molecular Weight 229.23
InChI InChI=1S/C13H11NO3/c1-15-8-3-4-9-11(7-8)14-13-10(5-6-17-13)12(9)16-2/h3-7H,1-2H3
InChI Key TWGHMXOYRUTQOL-UHFFFAOYSA-N
Melting Point 114-115 °C
Purity 95%+
Complexity 273
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 229.07389321
Heavy Atom Count 17
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 0
Monoisotopic Mass 229.07389321
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 44.5 Ų
Custom Q&A

What is the chemical name of EVOLITRINE?

The chemical name of EVOLITRINE is 4,7-Dimethoxyfuro[2,3-b]quinoline.

What are some synonyms for EVOLITRINE?

Some synonyms for EVOLITRINE are O-Methylconfusameline, 4,7-dimethoxyfuro[2,3-b]quinoline, Evolitrine, 7-Methoxydictamnine, and Inhibitor.

What is the CAS number of EVOLITRINE?

The CAS number of EVOLITRINE is 523-66-0.

What is the molecular formula of EVOLITRINE?

The molecular formula of EVOLITRINE is C13H11NO3.

What is the molecular weight of EVOLITRINE?

The molecular weight of EVOLITRINE is 229.23 g/mol.

What is the melting point of EVOLITRINE?

The melting point of EVOLITRINE is 114-115 °C.

What is the boiling point of EVOLITRINE?

The predicted boiling point of EVOLITRINE is 381.0±37.0 °C.

What is the density of EVOLITRINE?

The predicted density of EVOLITRINE is 1.261±0.06 g/cm3.

What is the pka value of EVOLITRINE?

The predicted pka value of EVOLITRINE is 7.87±0.40.

What are some of the properties of EVOLITRINE?

Some properties of EVOLITRINE include a melting point of 114-115 °C, a boiling point of 381.0±37.0 °C, a density of 1.261±0.06 g/cm3, and a predicted pka value of 7.87±0.40.

※ Please kindly note that our products are for research use only.