Flindersine

Flindersine

Inquiry
Catalog Number ACM523648-1
CAS Number 523-64-8
Structure
Description Flindersine is a coumarin derivative that has been found to have cytotoxic properties. Flindersine binds to nucleic acids, causing strand breaks in DNA and inhibiting RNA synthesis. It is also known to inhibit the growth of cervical cancer cells by inducing cell cycle arrest. The cytotoxicity of flindersine has been shown in culture systems and in animal models of leukemia. The mechanism of action on hematopoietic cells is based on the ability of flindersine to bind to DNA and form covalent bonds with the guanine residues. This inhibits DNA replication, leading to cell death.
Molecular Weight 227.26 g/mol
Molecular Formula C14H13NO2
Canonical SMILES CC1(C=CC2=C(O1)C3=CC=CC=C3NC2=O)C
Custom Q&A

What is the chemical formula of flindersine?

The chemical formula of flindersine is C14H13NO2.

What is the molar mass of flindersine?

The molar mass of flindersine is 227.26 g/mol.

What are synonyms for flindersine?

One synonym for flindersine is also flindersine.

What is the molecular structure of flindersine?

The molecular structure of flindersine consists of 14 carbon atoms, 13 hydrogen atoms, one nitrogen atom, and two oxygen atoms.

What is the molecular weight of flindersine?

The molecular weight of flindersine is 227.26 g/mol.

How many carbon atoms are present in the chemical formula of flindersine?

There are 14 carbon atoms in the chemical formula of flindersine.

What is the molecular formula of flindersine?

The molecular formula of flindersine is C14H13NO2.

What type of compound is flindersine?

Flindersine is a natural product alkaloid compound.

※ Please kindly note that our products are for research use only.