Galantamine hydrobromide

Catalog Number	ACM1953044-1
CAS Number	1953-04-4
Structure
Synonyms	Reminyl
IUPAC Name	(1S,12S,14R)-9-Methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol;hydrobromide
Molecular Weight	368.27
Molecular Formula	C17H22BRNO3
Canonical SMILES	CN1CCC23C=CC(CC2OC4=C(C=CC(=C34)C1)OC)O.Br
InChI	InChI=1S/C17H21NO3.BrH/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17;/h3-6,12,14,19H,7-10H2,1-2H3;1H/t12-,14-,17-;/m0./s1
InChI Key	QORVDGQLPPAFRS-XPSHAMGMSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	440
Exact Mass	367.07831
Heavy Atom Count	22
Isomeric SMILES	CN1CC[C@@]23C=C[C@@H](C[C@@H]2OC4=C(C=CC(=C34)C1)OC)O.Br
Monoisotopic Mass	367.07831
Topological Polar Surface Area	41.9Ų

Custom Q&A

What is the chemical formula for Galanthamine Hydrobromide?

The chemical formula for Galanthamine Hydrobromide is C17H22BrNO3.

What is the molecular weight of Galanthamine Hydrobromide?

The molecular weight of Galanthamine Hydrobromide is 368.27.

What are some synonyms for Galanthamine Hydrobromide?

Some synonyms for Galanthamine Hydrobromide are jilkonhydrobromide, lycoreminehydrobromide, and GALANTAMINE HBR.

What is the storage temperature recommended for Galanthamine Hydrobromide?

The storage temperature recommended for Galanthamine Hydrobromide is Room Temperature, sealed in dry.

What are the hazard codes associated with Galanthamine Hydrobromide?

The hazard code associated with Galanthamine Hydrobromide is T.

How does Galanthamine Hydrobromide function as a biochem/physiol agent?

Galanthamine Hydrobromide is a competitive and reversible inhibitor of acetylcholinesterase, acting as an antimyasthenic agent.

What is the primary target of Galanthamine Hydrobromide?

The primary target of Galanthamine Hydrobromide is acetylcholinesterase.

What is the clinical use of Galanthamine Hydrobromide?

Galanthamine Hydrobromide is indicated for the treatment of mild-to-moderate Alzheimer's disease and dementia, as well as being used as an anticurare agent in anesthesia.

How is Galanthamine Hydrobromide metabolized in the body?

Galanthamine Hydrobromide is metabolized by CYP2D6 and CYP3A4 to afford various metabolites, with an elimination half-life of 5.7 hours.

What sets Galanthamine Hydrobromide apart from other cholinesterase inhibitors?

Galanthamine Hydrobromide differs from other cholinesterase inhibitors because it allosterically binds to nicotinic receptors, giving it a dual cholinergic action.

※ Please kindly note that our products are for research use only.