gamma-Truxilline

Catalog Number	ACM113350564
CAS Number	113350-56-4
Synonyms	γ-Truxilline
Molecular Weight	658.8
InChI	InChI=1S/C38H46N2O8/c1-39-23-15-17-25(39)31(35(41)45-3)27(19-23)47-37(43)33-29(21-11-7-5-8-12-21)34(30(33)22-13-9-6-10-14-22)38(44)48-28-20-24-16-18-26(40(24)2)32(28)36(42)46-4/h5-14,23-34H,15-20H2,1-4H3/t23-,24-,25+,26+,27-,28,29,30,31+,32+,33,34/m0/s1
InChI Key	BUOSLGZEBFSUDD-KTGNHJTISA-N
Purity	95%+
Complexity	1110
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	7
Exact Mass	658.32541643
Heavy Atom Count	48
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)OC(=O)C3C(C(C3C4=CC=CC=C4)C(=O)OC5C[C@@H]6CC[C@H]([C@H]5C(=O)OC)N6C)C7=CC=CC=C7)C(=O)OC
Monoisotopic Mass	658.32541643
PhysicalState	Powder
Rotatable Bond Count	12
Topological Polar Surface Area	112 Ų

Custom Q&A

What is the chemical formula for γ-Truxilline?

The chemical formula for γ-Truxilline is C38H46N2O8.

What is the molecular weight of γ-Truxilline?

The molecular weight of γ-Truxilline is 658.79.

What are some synonyms for γ-Truxilline?

Some synonyms for γ-Truxilline include gamma-Truxilline and 1,3-Cyclobutanedicarboxylic acid, 2,4-diphenyl-, 1,3-bis[(1R,2R,3S,5S)-2-(methoxycarbonyl)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] ester, (1α,2α,3α,4β)-.

What is the CAS number for γ-Truxilline?

The CAS number for γ-Truxilline is 113350-56-4.

What is the predicted density of γ-Truxilline?

The predicted density of γ-Truxilline is 1.29±0.1 g/cm3.

What is the predicted pka of γ-Truxilline?

The predicted pka of γ-Truxilline is 9.09±0.60.

How many carbons, hydrogens, nitrogens, and oxygens are present in the molecular formula of γ-Truxilline?

There are 38 carbons, 46 hydrogens, 2 nitrogens, and 8 oxygens present in the molecular formula of γ-Truxilline.

What type of compound is γ-Truxilline?

γ-Truxilline is a diphenylcycloalkane ester.

What is the predicted molecular structure of γ-Truxilline?

The predicted molecular structure of γ-Truxilline is a 1,3-bis[(1R,2R,3S,5S)-2-(methoxycarbonyl)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] ester.

※ Please kindly note that our products are for research use only.