Gelsemine

Catalog Number	ACM509159-2
CAS Number	509-15-9
IUPAC Name	(1'R,2'S,3S,5'S,6'S,8'R,11'S)-2'-Ethenyl-4'-methylspiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2-one
Molecular Weight	322.40
Molecular Formula	C20H22N2O2
Canonical SMILES	CN1CC2(C3CC4C5(C2C1C3CO4)C6=CC=CC=C6NC5=O)C=C
InChI	InChI=1S/C20H22N2O2/c1-3-19-10-22(2)16-11-9-24-15(8-13(11)19)20(17(16)19)12-6-4-5-7-14(12)21-18(20)23/h3-7,11,13,15-17H,1,8-10H2,2H3,(H,21,23)/t11-,13+,15+,16+,17-,19-,20-/m0/s1
InChI Key	NFYYATWFXNPTRM-QJICHLCESA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	635
Exact Mass	322.168127949
Heavy Atom Count	24
Isomeric SMILES	CN1C[C@]2([C@@H]3C[C@@H]4[C@]5([C@H]2[C@H]1[C@H]3CO4)C6=CC=CC=C6NC5=O)C=C
Monoisotopic Mass	322.168127949
Topological Polar Surface Area	41.6Ų

Custom Q&A

What is the chemical formula for Gelsemine?

The chemical formula for Gelsemine is C20H22N2O2.

What is the molecular weight of Gelsemine?

The molecular weight of Gelsemine is 322.4.

What is the storage temperature recommended for Gelsemine?

The recommended storage temperature for Gelsemine is 2-8°C.

What is the color of Gelsemine in its powder form?

Gelsemine is white in color in its powder form.

What is the hazardous code for Gelsemine?

The hazardous code for Gelsemine is T+.

What is the main use of Gelsemine?

Gelsemine is used in medicine as a CNS stimulant.

What is the boiling point of Gelsemine?

The boiling point of Gelsemine is approximately 461.02°C.

What is the solubility of Gelsemine in chloroform and methanol?

Gelsemine is slightly soluble in chloroform and methanol.

What is the melting point range of Gelsemine?

The melting point range of Gelsemine is 181-183°C.

What are the risk statements associated with Gelsemine?

The risk statements associated with Gelsemine are 23/24/25-26/27/28.

※ Please kindly note that our products are for research use only.