Gliotoxin

Catalog Number	ACM67992-1
CAS Number	67-99-2
Synonyms	Aspergillin
IUPAC Name	(1R,7S,8S,11R)-7-Hydroxy-11-(hydroxymethyl)-15-methyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5-diene-10,14-dione
Molecular Weight	326.39
Molecular Formula	C13H14N2O4S2
Canonical SMILES	CN1C(=O)C23CC4=CC=CC(C4N2C(=O)C1(SS3)CO)O
InChI	InChI=1S/C13H14N2O4S2/c1-14-10(18)12-5-7-3-2-4-8(17)9(7)15(12)11(19)13(14,6-16)21-20-12/h2-4,8-9,16-17H,5-6H2,1H3/t8-,9-,12+,13+/m0/s1
InChI Key	FIVPIPIDMRVLAY-RBJBARPLSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	621
Exact Mass	326.03949928
Heavy Atom Count	21
Isomeric SMILES	CN1C(=O)[C@]23CC4=CC=C[C@@H]([C@H]4N2C(=O)[C@]1(SS3)CO)O
Monoisotopic Mass	326.03949928
Topological Polar Surface Area	132Ų

Custom Q&A

What is the molecular formula of Gliotoxin?

The molecular formula of Gliotoxin is C13H14N2O4S2.

What are the synonyms for Gliotoxin?

The synonyms for Gliotoxin include Gladiocladium fimbriatum and Aspergillin.

What is the melting point of Gliotoxin?

The melting point of Gliotoxin is approximately 221°C.

What are the hazard codes associated with Gliotoxin?

The hazard codes associated with Gliotoxin are T, Xn, and F.

What is the main product category of Gliotoxin?

The main product category of Gliotoxin is an antibiotic.

How does Gliotoxin affect the immune system?

Gliotoxin induces apoptosis in monocytes and dendritic cells and reduces phagocytosis by neutrophils, thus suppressing the immune response.

What is the toxicity of Gliotoxin in mice?

The LD50 oral toxicity of Gliotoxin in mice is 67mg/kg.

What are the potential uses of Gliotoxin?

Gliotoxin exhibits inhibitory activities against histone H3K9 methyltransferase, immunosuppressive properties, and potential anti-inflammatory, antibiotic, antifungal, and antiviral activities.

How is Gliotoxin purified?

Gliotoxin can be purified by recrystallization from MeOH, and its solubility in CHCl3 is 1%.

What is the safety profile of Gliotoxin?

Gliotoxin is considered a poison by intraperitoneal and intravenous routes, and when heated to decomposition, it emits very toxic fumes such as SOx and NOx.

※ Please kindly note that our products are for research use only.