Guanine

Catalog Number	ACM73405-2
CAS Number	73-40-5
Synonyms	2-Aminohypoxanthine
IUPAC Name	2-Amino-1,7-dihydropurin-6-one
Molecular Weight	151.13
Molecular Formula	C5H5N5O
Canonical SMILES	C1=NC2=C(N1)C(=O)NC(=N2)N
InChI	InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)
InChI Key	UYTPUPDQBNUYGX-UHFFFAOYSA-N
Purity	98%+(HPLC)
Solubility	Soluble in acids and bases, slightly soluble in ethanol and ether, insoluble in water.
Appearance	Off-white powder
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	225
Exact Mass	151.04940980
Heavy Atom Count	11
Monoisotopic Mass	151.04940980
Topological Polar Surface Area	96.2Ų

Custom Q&A

What is guanine and where is it found?

Guanine is an organic base that is widespread in the animal and plant kingdom.

How is guanine obtained through hydrolysis?

Guanine can be obtained through the hydrolysis of scale in hydrochloric acid.

What are the major bases in nucleic acids that guanine belongs to?

Guanine, together with adenine, constitutes the two major purine bases in nucleic acids.

How can guanine be connected to ribose or deoxyribose?

The N9 of guanine can be connected with the C1 of ribose or deoxyribose with a β-glycosidic bond to obtain guanosine or deoxyguanosine.

What is the chemical composition of 6-thioguanine?

The chemical composition of 6-thioguanine is 6-mercaptopurine.

What is the major use of guanine in biochemical research?

Guanine is used for biochemical research and the preparation of caffeine and other drugs.

How is guanine used in cosmetics?

Guanine obtained from fish scales is used in cosmetics, especially for eye cosmetics and nail polishes.

What is the melting point of guanine?

The melting point of guanine is greater than 300°C.

What is the solubility of guanine in water?

Guanine is practically insoluble in water.

What is the role of guanine in biological nucleic acids?

Guanine is one of the five nucleobases incorporated into biological nucleic acids DNA and RNA, where it plays a significant role in protein biosynthesis and the storage of genetic information.

※ Please kindly note that our products are for research use only.