Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione

Catalog Number	ACM14705603
CAS Number	14705-60-3
Synonyms	3-(Phenylmethyl)-2,3,6,7,8,8A-hexahydropyrrolo(2,1-F)pyrazine-1,4-dione
Molecular Weight	244.29
InChI	InChI=1S/C14H16N2O2/c17-13-12-7-4-8-16(12)14(18)11(15-13)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,15,17)
InChI Key	QZBUWPVZSXDWSB-UHFFFAOYSA-N
Purity	95%+
Complexity	350
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	244.121177757
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Monoisotopic Mass	244.121177757
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	49.4 Ų

Custom Q&A

What is the chemical name of Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione?

The chemical name is Pyrrolo(2,1-F)pyrazine-1,4-dione, 2,3,6,7,8,8A-hexahydro-3-(phenylmethyl)-.

What are some synonyms for Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione?

Some synonyms include Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione, Cyclo(D-phenylalanyl-L-prolyl), and Cyclo(Phe Pro).

What is the molecular formula of Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione?

The molecular formula is C14H16N2O2.

What is the molecular weight of Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione?

The molecular weight is 244.29 g/mol.

What is the boiling point of Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione?

The boiling point is predicted to be 509.5±39.0 °C.

What is the density of Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione?

The density is predicted to be 1.26±0.1 g/cm3.

What is the solubility of Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione in dimethylformamide (DMF)?

The solubility in DMF is 1 mg/ml.

What is the solubility of Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione in ethanol?

The solubility in ethanol is 1 mg/ml.

What form does Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione exist in?

The compound exists in solid form.

What is the predicted pKa value of Hexahydro-3-(phenylmethyl)pyrrolo[1,2-a]pyrazine-1,4-dione?

The predicted pKa value is 13.21±0.40.

※ Please kindly note that our products are for research use only.