Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione

Catalog Number	ACM19179125
CAS Number	19179-12-5
Structure
Synonyms	2,3,6,7,8,8a-Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
Molecular Weight	154.17
Molecular Formula	C7H10N2O2
InChI	InChI=1S/C7H10N2O2/c10-6-4-8-7(11)5-2-1-3-9(5)6/h5H,1-4H2,(H,8,11)/t5-/m0/s1
InChI Key	InChI=1S/C7H10N2O2/c10-6-4-8-7(11)5-2-1-3-9(5)6/h5H,1-4H2,(H,8,11)
Purity	95%+
Complexity	215
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	154.074227566
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C1CC2C(=O)NCC(=O)N2C1
Monoisotopic Mass	154.074227566
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	49.4 Ų

Custom Q&A

What is the chemical name of the compound HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE?

The chemical name is Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.

What are the synonyms of HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE?

The synonyms include cyclo(glycylprolyl), octahydropyrrolo[1,2-a]piperazine-1,4-dione, and Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-.

What is the CAS number of HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE?

The CAS number is 19179-12-5.

What is the molecular formula of HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE?

The molecular formula is C7H10N2O2.

What is the molecular weight of HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE?

The molecular weight is 154.17.

What are the product categories that HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE belongs to?

The product categories include PIPERIDINE and PYRROLE.

What is the boiling point of HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE?

The predicted boiling point is 447.9±34.0 °C.

What is the predicted density of HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE?

The predicted density is 1.32±0.1 g/cm3.

What is the predicted pKa value of HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE?

The predicted pKa value is 13.21±0.20.

How is Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione functionally related according to ChEBI?

It is functionally related to an alpha-amino acid.

※ Please kindly note that our products are for research use only.