Indole-3-glyoxylamide

Indole-3-glyoxylamide

Inquiry
Catalog Number ACM5548107
CAS Number 5548-10-7
Structure
Description Indole-3-glyoxylamide is a marine derived natural products found in Spongosorites sp.
Synonyms alpha-Oxo-1H-indole-3-acetamide
IUPAC Name 2-(1H-Indol-3-yl)-2-oxoacetamide
Molecular Weight 188.18
Molecular Formula C10H8N2O2
Canonical SMILES C1=CC=C2C(=C1)C(=CN2)C(=O)C(=O)N
InChI InChI=1S/C10H8N2O2/c11-10(14)9(13)7-5-12-8-4-2-1-3-6(7)8/h1-5,12H,(H2,11,14)
InChI Key AWMLDBKLOPNOAR-UHFFFAOYSA-N
Melting Point 252 °C (lit.)
Purity 95%+
Complexity 265
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 188.058577502
Heavy Atom Count 14
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 2
Monoisotopic Mass 188.058577502
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 76 Ų
Custom Q&A

What is the chemical formula for Indole-3-glyoxylamide?

The chemical formula for Indole-3-glyoxylamide is C10H8N2O2.

What is the molecular weight of Indole-3-glyoxylamide?

The molecular weight of Indole-3-glyoxylamide is 188.18.

What is the melting point of Indole-3-glyoxylamide?

The melting point of Indole-3-glyoxylamide is 252°C.

What is the predicted boiling point of Indole-3-glyoxylamide?

The predicted boiling point of Indole-3-glyoxylamide is 447.4±37.0 °C.

What is the color of Indole-3-glyoxylamide?

The color of Indole-3-glyoxylamide is light yellow.

What is the predicted density of Indole-3-glyoxylamide?

The predicted density of Indole-3-glyoxylamide is 1.402±0.06 g/cm3.

What are some synonyms for Indole-3-glyoxylamide?

Some synonyms for Indole-3-glyoxylamide include 2-(1H-indol-3-yl)-2-keto-acetamide and 3-Indoleglyoxamide.

What are the product categories that Indole-3-glyoxylamide belongs to?

Indole-3-glyoxylamide belongs to the category of Indoles and derivatives.

What is the pka value of Indole-3-glyoxylamide?

The pka value of Indole-3-glyoxylamide is 13.02±0.50.

What is the water hazard class for Indole-3-glyoxylamide in Germany?

The water hazard class for Indole-3-glyoxylamide in Germany is WGK 3.

※ Please kindly note that our products are for research use only.