Isoretronecanol

Catalog Number	ACM526636
CAS Number	526-63-6
Synonyms	(1S,7aα)-Hexahydro-1H-pyrrolizine-1-methanol
Molecular Weight	141.21
InChI	InChI=1S/C8H15NO/c10-6-7-3-5-9-4-1-2-8(7)9/h7-8,10H,1-6H2/t7-,8+/m1/s1
InChI Key	LOFDEIYZIAVXHE-SFYZADRCSA-N
Purity	95%+
Complexity	126
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	141.115364102
Heavy Atom Count	10
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C1C[C@H]2[C@H](CCN2C1)CO
Monoisotopic Mass	141.115364102
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	23.5 Ų

Custom Q&A

What is the chemical name of isoretronecanol?

The chemical name of isoretronecanol is ((1S,7aS)-Hexahydro-1H-pyrrolizin-1-yl)methanol.

What is the CAS number of isoretronecanol?

The CAS number of isoretronecanol is 526-63-6.

What is the molecular formula of isoretronecanol?

The molecular formula of isoretronecanol is C8H15NO.

What is the molecular weight of isoretronecanol?

The molecular weight of isoretronecanol is 141.21.

What is the pKa value of isoretronecanol at 25°C?

The pKa value of isoretronecanol at 25°C is 10.83.

What are the synonyms of isoretronecanol?

The synonyms of isoretronecanol include isoretronecanol and (1S,7aα)-Hexahydro-1H-pyrrolizine-1-methanol.

What is the structure of isoretronecanol?

The structure of isoretronecanol consists of a hexahydro-1H-pyrrolizine ring attached to a methanol group.

Why is the pKa value of isoretronecanol important?

The pKa value of isoretronecanol is important as it indicates the strength of its acidic properties.

How can isoretronecanol be used in research or industry?

Isoretronecanol can be used in research or industry for various chemical and pharmaceutical applications due to its unique chemical structure.

※ Please kindly note that our products are for research use only.