Isotetrandrine

Isotetrandrine

Inquiry
Catalog Number ACM477576
CAS Number 477-57-6
Structure
Synonyms O-Methylberbamine
Molecular Weight 622.7
InChI InChI=1S/C38H42N2O6/c1-39-15-13-25-20-32(42-4)34-22-28(25)29(39)17-23-7-10-27(11-8-23)45-33-19-24(9-12-31(33)41-3)18-30-36-26(14-16-40(30)2)21-35(43-5)37(44-6)38(36)46-34/h7-12,19-22,29-30H,13-18H2,1-6H3/t29-,30+/m0/s1
InChI Key WVTKBKWTSCPRNU-XZWHSSHBSA-N
Melting Point 180-182 °C
Purity 95%+
Complexity 979
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 2
Exact Mass 622.30428706
Heavy Atom Count 46
Hydrogen Bond Acceptor Count 8
Hydrogen Bond Donor Count 0
Isomeric SMILES CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@@H]6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC
Monoisotopic Mass 622.30428706
PhysicalState Powder
Rotatable Bond Count 4
Topological Polar Surface Area 61.9 Ų
Custom Q&A

What is the chemical formula of ISOTETRANDRINE?

The chemical formula of ISOTETRANDRINE is C38H42N2O6.

What is the molecular weight of ISOTETRANDRINE?

The molecular weight of ISOTETRANDRINE is 622.76.

What is the melting point of ISOTETRANDRINE?

The melting point of ISOTETRANDRINE is 180-182℃.

In what solvents is ISOTETRANDRINE soluble?

ISOTETRANDRINE is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the usage of ISOTETRANDRINE?

ISOTETRANDRINE is a biscoclaurine alkaloid inhibitor of G protein activation of PLA2.

What is the target of ISOTETRANDRINE?

The target of ISOTETRANDRINE includes IL Receptor, NF-kB, MAPK, Nrf2, HO-1, JNK.

Where does ISOTETRANDRINE naturally occur?

ISOTETRANDRINE naturally occurs in Ath ierospi rn a rnoschaturn, Berberis japonica, and Stephania cephalantha.

How is ISOTETRANDRINE synthesized?

ISOTETRANDRINE is synthesized according to Inubushi et al., Tetrahedron Lett., 3399 (1968).

What are some of the synonyms for ISOTETRANDRINE?

Some synonyms for ISOTETRANDRINE include 1-isotetrandrine, berbamine methyl ether, o,o'-dimethylobamegine, etc.

What are the main chemical properties of ISOTETRANDRINE?

The main chemical properties of ISOTETRANDRINE include a boiling point of 710.5±60.0 °C, a density of 1.172, and solubility in various solvents.

※ Please kindly note that our products are for research use only.